EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2 |
| Net Charge | 0 |
| Average Mass | 122.171 |
| Monoisotopic Mass | 122.08440 |
| SMILES | CCc1cnc(C)cn1 |
| InChI | InChI=1S/C7H10N2/c1-3-7-5-8-6(2)4-9-7/h4-5H,3H2,1-2H3 |
| InChIKey | OXCKCFJIKRGXMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethyl-5-methylpyrazine (CHEBI:141542) has role flavouring agent (CHEBI:35617) |
| 2-ethyl-5-methylpyrazine (CHEBI:141542) has role Maillard reaction product (CHEBI:77523) |
| 2-ethyl-5-methylpyrazine (CHEBI:141542) is a pyrazines (CHEBI:38314) |
| 2-ethyl-5-methylpyrazine (CHEBI:141542) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 2-ethyl-5-methylpyrazine |
| Synonyms | Source |
|---|---|
| 2,5-methylethylpyrazine | HMDB |
| 2-ethyl-5-methyl-pyrazine | HMDB |
| 2-methyl-5-ethylpyrazine | HMDB |
| FEMA 3154 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 24144 | ChemSpider |
| FDB021558 | FooDB |
| HMDB0041568 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:956719 | Reaxys |
| CAS:13360-64-0 | ChemIDplus |
| CAS:13360-64-0 | NIST Chemistry WebBook |
| Citations |
|---|