EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141540 - Myricanone
| Formula | C21H24O5 |
| Net Charge | 0 |
| Average Mass | 356.418 |
| Monoisotopic Mass | 356.16237 |
| SMILES | COc1c2cc(c(O)c1OC)CCCCC(=O)CCc1ccc(O)c-2c1 |
| InChI | InChI=1S/C21H24O5/c1-25-20-17-12-14(19(24)21(20)26-2)5-3-4-6-15(22)9-7-13-8-10-18(23)16(17)11-13/h8,10-12,23-24H,3-7,9H2,1-2H3 |
| InChIKey | ZTSNTUQTNQSIDC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Morella salicifolia (ncbitaxon:385014) | bark (BTO:0001301) | PubMed (29257058) | |
| Morella cerifera (ncbitaxon:3510) | bark (BTO:0001301) | PubMed (27492128) | |
| Myrica adenophora (IPNI:585476-1) | root (BTO:0001188) | PubMed (24810013) | |
| Morella rubra (ncbitaxon:262757) | |||
| bark (BTO:0001301) | PubMed (23066712) | ||
| bark (BTO:0001301) | PubMed (11848211) | ||
| Myrica nana (IPNI:585572-1) | root (BTO:0001188) | Article (Yu, Y.F., Lu, Q., Guo, L., Mei, R.Q., Liang, H.X., Luo, D.Q. and Cheng, Y.X. (2007) Myricananone and myricananadiol: two new cyclic diarylheptanoids from the Roots of Myrica nana. Helv. Chim. Acta, 90(9), 1691-1696.) | |
| Morella esculenta (ncbitaxon:385002) | bark (BTO:0001301) | Article (Sun, D., Zhao, Z., Wong, H. and Foo L.Y. (1988) Tannins and other phenolics from Myrica esculenta bark. Phytochemistry, 27(2), 579-583.) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myricanone (CHEBI:141540) has role antineoplastic agent (CHEBI:35610) |
| Myricanone (CHEBI:141540) has role plant metabolite (CHEBI:76924) |
| Myricanone (CHEBI:141540) is a aromatic ether (CHEBI:35618) |
| Myricanone (CHEBI:141540) is a cyclic ketone (CHEBI:3992) |
| Myricanone (CHEBI:141540) is a diarylheptanoid (CHEBI:78802) |
| Myricanone (CHEBI:141540) is a methoxybenzenes (CHEBI:51683) |
| Myricanone (CHEBI:141540) is a phenols (CHEBI:33853) |
| Manual Xrefs | Databases |
|---|---|
| 142062 | ChemSpider |
| FDB002739 | FooDB |
| Myricanone | Wikipedia |
| C00033235 | KNApSAcK |
| HMDB0030798 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2064341 | Reaxys |
| CAS:32492-74-3 | KNApSAcK |
| CAS:32492-74-3 | ChemIDplus |
| Citations |
|---|