EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O5 |
| Net Charge | 0 |
| Average Mass | 396.483 |
| Monoisotopic Mass | 396.19367 |
| SMILES | CC1=CC(=O)C2C(C)(C)C(O)CCC2(C)C1COc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C24H28O5/c1-14-11-18(25)22-23(2,3)20(26)9-10-24(22,4)17(14)13-28-16-7-5-15-6-8-21(27)29-19(15)12-16/h5-8,11-12,17,20,22,26H,9-10,13H2,1-4H3 |
| InChIKey | HIQLOIOGTRDMIW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-[(6-hydroxy-2,5,5,8a-tetramethyl-4-oxo-1,4,4a,5,6,7,8,8a-octahydro-1-naphthalenyl)methoxy]-2H-chromen-2-one (CHEBI:141536) is a coumarin (CHEBI:28794) |
| Manual Xrefs | Databases |
|---|---|
| 2956265 | ChemSpider |