EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28BN3O5 |
| Net Charge | 0 |
| Average Mass | 413.283 |
| Monoisotopic Mass | 413.21220 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)n1)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C21H28BN3O5/c1-13(2)12-18(22(29)30)24-21(28)19(14(3)26)25-20(27)17-11-7-10-16(23-17)15-8-5-4-6-9-15/h4-11,13-14,18-19,26,29-30H,12H2,1-3H3,(H,24,28)(H,25,27)/t14-,18+,19+/m1/s1 |
| InChIKey | SJFBTAPEPRWNKH-CCKFTAQKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delanzomib (CHEBI:141530) has functional parent L-threonine (CHEBI:16857) |
| delanzomib (CHEBI:141530) has role antineoplastic agent (CHEBI:35610) |
| delanzomib (CHEBI:141530) has role apoptosis inducer (CHEBI:68495) |
| delanzomib (CHEBI:141530) has role proteasome inhibitor (CHEBI:52726) |
| delanzomib (CHEBI:141530) is a C-terminal boronic acid peptide (CHEBI:140517) |
| delanzomib (CHEBI:141530) is a phenylpyridine (CHEBI:38193) |
| delanzomib (CHEBI:141530) is a secondary alcohol (CHEBI:35681) |
| delanzomib (CHEBI:141530) is a threonine derivative (CHEBI:26987) |
| IUPAC Name |
|---|
| [(1R)-3-methyl-1-({N-[(6-phenylpyridin-2-yl)carbonyl]-L-threonyl}amino)butyl]boronic acid |
| INNs | Source |
|---|---|
| delanzomib | WHO MedNet |
| délanzomib | WHO MedNet |
| delanzomibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| [(1R)-1-[[(2S,3R)-3-hydroxy-1-oxo-2-[[oxo-(6-phenyl-2-pyridyl)methyl]amino]butyl]amino]-3-methylbutyl]boronic acid | ChEBI |
| [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(6-phenylpyridin-2-yl)carbonylamino]butanoyl]amino]-3-methyl-butyl]boronic acid | ChEBI |
| boronic acid, ((1R)-1-(((2S,3R)-3-hydroxy-1-oxo-2-(((6-phenyl-2-pyridinyl)carbonyl)amino)butyl)amino)-3-methylbutyl)- | ChemIDplus |
| CEP-18770 | ChEBI |
| CT-47098 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D10110 | KEGG DRUG |
| DB11956 | DrugBank |
| WO2011087822 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12211043 | Reaxys |
| CAS:847499-27-8 | DrugBank |
| CAS:847499-27-8 | ChemIDplus |
| Citations |
|---|