EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19NO6 |
| Net Charge | 0 |
| Average Mass | 369.373 |
| Monoisotopic Mass | 369.12124 |
| SMILES | C[C@@H]1Cc2ccc(C(=O)N[C@@H](Cc3ccccc3)C(=O)O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H19NO6/c1-11-9-13-7-8-14(17(22)16(13)20(26)27-11)18(23)21-15(19(24)25)10-12-5-3-2-4-6-12/h2-8,11,15,22H,9-10H2,1H3,(H,21,23)(H,24,25)/t11-,15+/m1/s1 |
| InChIKey | DAEYIVCTQUFNTM-ABAIWWIYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . mycotoxin Poisonous substance produced by fungi. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochratoxin B (CHEBI:141524) has role Aspergillus metabolite (CHEBI:76956) |
| ochratoxin B (CHEBI:141524) has role Penicillium metabolite (CHEBI:76964) |
| ochratoxin B (CHEBI:141524) has role calcium channel blocker (CHEBI:38215) |
| ochratoxin B (CHEBI:141524) has role mycotoxin (CHEBI:25442) |
| ochratoxin B (CHEBI:141524) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| ochratoxin B (CHEBI:141524) is a isochromanes (CHEBI:38762) |
| ochratoxin B (CHEBI:141524) is a monocarboxylic acid (CHEBI:25384) |
| ochratoxin B (CHEBI:141524) is a phenylalanine derivative (CHEBI:25985) |
| ochratoxin B (CHEBI:141524) is conjugate acid of ochratoxin B(1−) (CHEBI:192526) |
| Incoming Relation(s) |
| ochratoxin B(1−) (CHEBI:192526) is conjugate base of ochratoxin B (CHEBI:141524) |
| IUPAC Name |
|---|
| N-[(3R)-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carbonyl]-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(3R)-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carbonyl]amino}-3-phenylpropanoic acid | IUPAC |
| N-{[(3R)-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-isochromen-7-yl]carbonyl}-L-phenylalanine | IUPAC |
| OTB | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00037570 | KNApSAcK |
| HMDB0029401 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1300160 | Reaxys |
| CAS:4825-86-9 | ChemIDplus |
| Citations |
|---|