EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19NO6 |
| Net Charge | 0 |
| Average Mass | 369.373 |
| Monoisotopic Mass | 369.12124 |
| SMILES | C[C@@H]1Cc2ccc(C(=O)N[C@@H](Cc3ccccc3)C(=O)O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C20H19NO6/c1-11-9-13-7-8-14(17(22)16(13)20(26)27-11)18(23)21-15(19(24)25)10-12-5-3-2-4-6-12/h2-8,11,15,22H,9-10H2,1H3,(H,21,23)(H,24,25)/t11-,15+/m1/s1 |
| InChIKey | DAEYIVCTQUFNTM-ABAIWWIYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ochratoxin B (CHEBI:141524) has role Aspergillus metabolite (CHEBI:76956) |
| ochratoxin B (CHEBI:141524) has role Penicillium metabolite (CHEBI:76964) |
| ochratoxin B (CHEBI:141524) has role calcium channel blocker (CHEBI:38215) |
| ochratoxin B (CHEBI:141524) has role mycotoxin (CHEBI:25442) |
| ochratoxin B (CHEBI:141524) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| ochratoxin B (CHEBI:141524) is a isochromanes (CHEBI:38762) |
| ochratoxin B (CHEBI:141524) is a monocarboxylic acid (CHEBI:25384) |
| ochratoxin B (CHEBI:141524) is a phenylalanine derivative (CHEBI:25985) |
| ochratoxin B (CHEBI:141524) is conjugate acid of ochratoxin B(1−) (CHEBI:192526) |
| Incoming Relation(s) |
| ochratoxin B(1−) (CHEBI:192526) is conjugate base of ochratoxin B (CHEBI:141524) |
| IUPAC Name |
|---|
| N-[(3R)-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carbonyl]-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(3R)-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carbonyl]amino}-3-phenylpropanoic acid | IUPAC |
| N-{[(3R)-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-isochromen-7-yl]carbonyl}-L-phenylalanine | IUPAC |
| OTB | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00037570 | KNApSAcK |
| HMDB0029401 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1300160 | Reaxys |
| CAS:4825-86-9 | ChemIDplus |
| Citations |
|---|