EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13F3N2O4S |
| Net Charge | 0 |
| Average Mass | 362.329 |
| Monoisotopic Mass | 362.05481 |
| SMILES | Cc1nn(C)c(O)c1C(=O)c1ccc(C(F)(F)F)cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H13F3N2O4S/c1-7-11(13(21)19(2)18-7)12(20)9-5-4-8(14(15,16)17)6-10(9)24(3,22)23/h4-6,21H,1-3H3 |
| InChIKey | DWSPRBSLSXQIEJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carotenoid biosynthesis inhibitor Any pathway inhibitor that acts on the carotenoid biosynthesis pathway. EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrasulfotole (CHEBI:141518) has role agrochemical (CHEBI:33286) |
| pyrasulfotole (CHEBI:141518) has role carotenoid biosynthesis inhibitor (CHEBI:138208) |
| pyrasulfotole (CHEBI:141518) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| pyrasulfotole (CHEBI:141518) has role herbicide (CHEBI:24527) |
| pyrasulfotole (CHEBI:141518) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| pyrasulfotole (CHEBI:141518) is a aromatic ketone (CHEBI:76224) |
| pyrasulfotole (CHEBI:141518) is a pyrazole pesticide (CHEBI:38601) |
| pyrasulfotole (CHEBI:141518) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| (5-hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]methanone |
| Synonyms | Source |
|---|---|
| 2,5-dimethyl-4-(2-methylsulfonyl-4-(trifluoromethyl)benzoyl)-1H-pyrazol-3-one | ChemIDplus |
| (5-hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)[2-(methanesulfonyl)-4-(trifluoromethyl)phenyl]methanone | Alan Wood's Pesticides |
| (5-hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)(α,α,α-trifluoro-2-mesyl-p-tolyl)methanone | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| pyrasulfotole | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:365400-11-9 | Alan Wood's Pesticides |
| CAS:365400-11-9 | ChemIDplus |
| Citations |
|---|