EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C17H26O2)m.2(C2H4O)n.C29H44O2 |
| Net Charge | 0 |
| Average Mass | 775.168 |
| Monoisotopic Mass | 774.57984 |
| SMILES | [H]OCCOc1ccc(CC(C)(C)C(C)(C)C)cc1Cc1cc(CC(C)(C)C(C)(C)C)cc(Cc2cc(CC(C)(C)C(C)(C)C)ccc2OCCO[H])c1OCCO[H] |
| InChI | InChI=1S/C50H78O6/c1-45(2,3)48(10,11)32-35-16-18-42(54-23-20-51)38(26-35)30-40-28-37(34-50(14,15)47(7,8)9)29-41(44(40)56-25-22-53)31-39-27-36(17-19-43(39)55-24-21-52)33-49(12,13)46(4,5)6/h16-19,26-29,51-53H,20-25,30-34H2,1-15H3 |
| InChIKey | OCZNOKJDQKWBTM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | excipient A generally pharmacologically inactive substance that is formulated with the active ingredient of a medication. surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. inhibitor A substance that diminishes the rate of a chemical reaction. |
| Application: | excipient A generally pharmacologically inactive substance that is formulated with the active ingredient of a medication. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyloxapol (CHEBI:141517) has role apoptosis inducer (CHEBI:68495) |
| tyloxapol (CHEBI:141517) has role excipient (CHEBI:75324) |
| tyloxapol (CHEBI:141517) has role inhibitor (CHEBI:35222) |
| tyloxapol (CHEBI:141517) has role surfactant (CHEBI:35195) |
| tyloxapol (CHEBI:141517) is a polymer (CHEBI:60027) |
| INNs | Source |
|---|---|
| tiloxapol | ChemIDplus |
| tyloxapol | ChemIDplus |
| tyloxapol | ChemIDplus |
| tyloxapolum | ChEBI |
| Synonyms | Source |
|---|---|
| 4-(1,1,2,2-tetramethylbutyl)phenol polyer with formaldehyde and oxirane | ChEBI |
| p-(1,1,3,3-tetramethylbutyl)phenol polymer with ethylene oxide and formaldehyde | ChemIDplus |
| oxyethylated tertiary octylphenol formaldehyde polymer | ChEBI |
| p-isooctylpolyoxyethylenenphenol formaldehyde polymer | ChEBI |
| tyloxypal | ChEBI |
| Brand Names | Source |
|---|---|
| Alevaire | ChEBI |
| Superinone | ChEBI |
| Triton A-20 | ChEBI |
| Triton WR-1339 | ChEBI |
| Citations |
|---|