EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N7O6 |
| Net Charge | 0 |
| Average Mass | 443.420 |
| Monoisotopic Mass | 443.15533 |
| SMILES | Nc1nc2c(c(=O)n1)N=C(CNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)CN2 |
| InChI | InChI=1S/C19H21N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,12,21H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t12-/m0/s1 |
| InChIKey | OZRNSSUDZOLUSN-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrofolic acid (CHEBI:15633) has role Escherichia coli metabolite (CHEBI:76971) |
| dihydrofolic acid (CHEBI:15633) has role mouse metabolite (CHEBI:75771) |
| dihydrofolic acid (CHEBI:15633) is a dihydrofolic acids (CHEBI:23743) |
| dihydrofolic acid (CHEBI:15633) is conjugate acid of dihydrofolate(2−) (CHEBI:57451) |
| Incoming Relation(s) |
| dihydrofolate(2−) (CHEBI:57451) is conjugate base of dihydrofolic acid (CHEBI:15633) |
| IUPAC Name |
|---|
| N-(4-{[(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoyl)-L-glutamic acid |
| Synonyms | Source |
|---|---|
| 7,8-Dihydrofolate | KEGG COMPOUND |
| 7,8-Dihydrofolic acid | KEGG COMPOUND |
| 7,8-Dihydropteroylglutamate | KEGG COMPOUND |
| Dihydrofolate | KEGG COMPOUND |
| Dihydrofolic acid | KEGG COMPOUND |
| N-(7,8-dihydropteroyl)-L-glutamic acid | ChEBI |