EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N3O6S |
| Net Charge | 0 |
| Average Mass | 321.355 |
| Monoisotopic Mass | 321.09946 |
| SMILES | CSC[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H19N3O6S/c1-21-5-7(10(18)13-4-9(16)17)14-8(15)3-2-6(12)11(19)20/h6-7H,2-5,12H2,1H3,(H,13,18)(H,14,15)(H,16,17)(H,19,20)/t6-,7-/m0/s1 |
| InChIKey | QTQDDTSVRVWHMO-BQBZGAKWSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-methylglutathione zwitterion (CHEBI:141473) is a zwitterion (CHEBI:27369) |
| S-methylglutathione zwitterion (CHEBI:141473) is conjugate acid of S-methyl glutathione(1−) (CHEBI:141467) |
| S-methylglutathione zwitterion (CHEBI:141473) is tautomer of S-methylglutathione (CHEBI:141472) |
| Incoming Relation(s) |
| S-methyl glutathione(1−) (CHEBI:141467) is conjugate base of S-methylglutathione zwitterion (CHEBI:141473) |
| S-methylglutathione (CHEBI:141472) is tautomer of S-methylglutathione zwitterion (CHEBI:141473) |
| IUPAC Name |
|---|
| N-[(4S)-4-azaniumyl-4-carboxylatobutanoyl]-S-methyl-L-cysteinylglycine |