EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18F3NO |
| Net Charge | 0 |
| Average Mass | 345.364 |
| Monoisotopic Mass | 345.13405 |
| SMILES | CC(C)(C)c1ccc(C(C#N)C(=O)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F3NO/c1-19(2,3)14-10-8-13(9-11-14)16(12-24)18(25)15-6-4-5-7-17(15)20(21,22)23/h4-11,16H,1-3H3 |
| InChIKey | FZHNJBVBSYNCGX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-tert-butylphenyl)-3-oxo-3-[2-(trifluoromethyl)phenyl]propanenitrile (CHEBI:141469) has role acaricide (CHEBI:22153) |
| 2-(4-tert-butylphenyl)-3-oxo-3-[2-(trifluoromethyl)phenyl]propanenitrile (CHEBI:141469) has role mitochondrial respiratory-chain inhibitor (CHEBI:25355) |
| 2-(4-tert-butylphenyl)-3-oxo-3-[2-(trifluoromethyl)phenyl]propanenitrile (CHEBI:141469) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| 2-(4-tert-butylphenyl)-3-oxo-3-[2-(trifluoromethyl)phenyl]propanenitrile (CHEBI:141469) is a aromatic ketone (CHEBI:76224) |
| 2-(4-tert-butylphenyl)-3-oxo-3-[2-(trifluoromethyl)phenyl]propanenitrile (CHEBI:141469) is a β-ketonitrile (CHEBI:51854) |