EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | O=C(O)C1CCCCN1O |
| InChI | InChI=1S/C6H11NO3/c8-6(9)5-3-1-2-4-7(5)10/h5,10H,1-4H2,(H,8,9) |
| InChIKey | SEWARTPIJFHCRP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxypipecolic acid (CHEBI:141463) has functional parent pipecolic acid (CHEBI:17964) |
| N-hydroxypipecolic acid (CHEBI:141463) is a N-hydroxy-α-amino-acid (CHEBI:50760) |
| N-hydroxypipecolic acid (CHEBI:141463) is a piperidinemonocarboxylic acid (CHEBI:26148) |
| Incoming Relation(s) |
| N-hydroxy-L-pipecolic acid (CHEBI:140874) is a N-hydroxypipecolic acid (CHEBI:141463) |
| IUPAC Name |
|---|
| 1-hydroxypiperidine-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 1-hydroxy-2-piperidinecarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3937672 | Reaxys |
| Citations |
|---|