EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141411 - benzyl β-D-glucopyranoside
| Formula | C13H18O6 |
| Net Charge | 0 |
| Average Mass | 270.281 |
| Monoisotopic Mass | 270.11034 |
| SMILES | OC[C@H]1O[C@@H](OCc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | GKHCBYYBLTXYEV-UJPOAAIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Prunus mume (ncbitaxon:10210) | fruit (BTO:0000486) | PubMed (14709918) | |
| Sorbus tianschanica (ncbitaxon:691244) | - | PubMed (19385179) | |
| Acanthus ilicifolius (ncbitaxon:328098) | - | PubMed (17357554) | |
| Alpinia officinarum (ncbitaxon:199623) | rhizome (BTO:0001181) | PubMed (12166983) | |
| Chenopodium ambrosioides (ncbitaxon:330163) | - | PubMed (24761641) | |
| Asystasia intrusa (IPNI:45747-1) | aerial part (BTO:0001658) | PubMed (15304995) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzyl β-D-glucopyranoside (CHEBI:141411) has role plant metabolite (CHEBI:76924) |
| benzyl β-D-glucopyranoside (CHEBI:141411) is a benzenes (CHEBI:22712) |
| benzyl β-D-glucopyranoside (CHEBI:141411) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| benzyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (2R,3R,4S,5S,6R)-2-(benzyloxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol | ChEBI |
| phenylmethyl β-D-glucopyranoside | ChEBI |
| benzyl-O-β-D-glucopyranoside | ChEBI |
| 1-O-benzyl-β-D-glucopyranose | ChEBI |
| Citations |
|---|