EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4N2O2S |
| Net Charge | 0 |
| Average Mass | 180.188 |
| Monoisotopic Mass | 179.99935 |
| SMILES | O=C(O)c1cccc2nnsc12 |
| InChI | InChI=1S/C7H4N2O2S/c10-7(11)4-2-1-3-5-6(4)12-9-8-5/h1-3H,(H,10,11) |
| InChIKey | COAIOOWBEPAOFY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungicide A substance used to destroy fungal pests. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | fungicide A substance used to destroy fungal pests. plant activator Any compound that protects plants by activating their defence mechanisms. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) has role antifungal agrochemical (CHEBI:86328) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) has role fungicide (CHEBI:24127) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) has role plant activator (CHEBI:73182) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) is a aromatic carboxylic acid (CHEBI:33859) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) is a benzothiadiazole (CHEBI:48864) |
| IUPAC Name |
|---|
| 1,2,3-benzothiadiazole-7-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1,2,3-Benzothiadiazol-7-carbonsäure | ChEBI |
| 1,2,3-benzothiadiazole-7-carboxylic acid | ChEBI |
| 7-carboxybenzothiadiazole | ChEBI |
| acibenzolar acid | ChEBI |
| Acide 1,2,3-benzothiadiazole-7-carboxylique | ChEBI |
| benzo-1,2,3-thiadiazole-7-carboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:975928 | Reaxys |
| CAS:35272-27-6 | ChemIDplus |
| Citations |
|---|