EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4N2O2S |
| Net Charge | 0 |
| Average Mass | 180.188 |
| Monoisotopic Mass | 179.99935 |
| SMILES | O=C(O)c1cccc2nnsc12 |
| InChI | InChI=1S/C7H4N2O2S/c10-7(11)4-2-1-3-5-6(4)12-9-8-5/h1-3H,(H,10,11) |
| InChIKey | COAIOOWBEPAOFY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. plant activator Any compound that protects plants by activating their defence mechanisms. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) has role antifungal agrochemical (CHEBI:86328) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) has role fungicide (CHEBI:24127) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) has role plant activator (CHEBI:73182) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) is a aromatic carboxylic acid (CHEBI:33859) |
| 1,2,3-benzothiadiazole-7-carboxylic acid (CHEBI:141405) is a benzothiadiazole (CHEBI:48864) |
| IUPAC Name |
|---|
| 1,2,3-benzothiadiazole-7-carboxylic acid |
| Synonyms | Source |
|---|---|
| benzo[d][1,2,3]thiadiazole-7-carboxylic acid | IUPAC |
| 1,2,3-benzothiadiazole-7-carboxylic acid | ChEBI |
| 7-carboxybenzothiadiazole | ChEBI |
| benzo-1,2,3-thiadiazole-7-carboxylic acid | ChEBI |
| CGA 210 007 | ChEBI |
| acibenzolar acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:975928 | Reaxys |
| CAS:35272-27-6 | ChemIDplus |
| Citations |
|---|