EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H23N3O |
| Net Charge | 0 |
| Average Mass | 309.413 |
| Monoisotopic Mass | 309.18411 |
| SMILES | Cc1nn(C)c(C(O)=C(C#N)c2ccc(C(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C19H23N3O/c1-12-13(2)21-22(6)17(12)18(23)16(11-20)14-7-9-15(10-8-14)19(3,4)5/h7-10,23H,1-6H3 |
| InChIKey | XKBKVWOCMYMJQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-tert-butylphenyl)-3-hydroxy-3-(1,3,4-trimethyl-1H-pyrazol-5-yl)acrylonitrile (CHEBI:141385) has role acaricide (CHEBI:22153) |
| 2-(4-tert-butylphenyl)-3-hydroxy-3-(1,3,4-trimethyl-1H-pyrazol-5-yl)acrylonitrile (CHEBI:141385) has role agrochemical (CHEBI:33286) |
| 2-(4-tert-butylphenyl)-3-hydroxy-3-(1,3,4-trimethyl-1H-pyrazol-5-yl)acrylonitrile (CHEBI:141385) is a benzenes (CHEBI:22712) |
| 2-(4-tert-butylphenyl)-3-hydroxy-3-(1,3,4-trimethyl-1H-pyrazol-5-yl)acrylonitrile (CHEBI:141385) is a enol (CHEBI:33823) |
| 2-(4-tert-butylphenyl)-3-hydroxy-3-(1,3,4-trimethyl-1H-pyrazol-5-yl)acrylonitrile (CHEBI:141385) is a nitrile (CHEBI:18379) |
| 2-(4-tert-butylphenyl)-3-hydroxy-3-(1,3,4-trimethyl-1H-pyrazol-5-yl)acrylonitrile (CHEBI:141385) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 2-(4-tert-butylphenyl)-3-hydroxy-3-(1,3,4-trimethyl-1H-pyrazol-5-yl)acrylonitrile |
| Synonym | Source |
|---|---|
| 3-hydroxy-3-(1,3,4-trimethyl-1H-pyrazol-5-yl)-2-(4-tert-butylphenyl)acrylonitrile | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22292325 | Reaxys |
| Citations |
|---|