EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O6 |
| Net Charge | 0 |
| Average Mass | 198.130 |
| Monoisotopic Mass | 198.01644 |
| SMILES | O=C(O)c1cc(O)c(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C8H6O6/c9-5-2-3(7(11)12)1-4(6(5)10)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | FBOCZYIJDQZQFE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces toyocaensis (ncbitaxon:55952) | - | PubMed (620673) | Strain: 1039 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 4.1.1.15 (glutamate decarboxylase) inhibitor An EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of glutamate decarboxylase (EC 4.1.1.15). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dihydroxyisophthalic acid (CHEBI:141383) has role bacterial metabolite (CHEBI:76969) |
| 4,5-dihydroxyisophthalic acid (CHEBI:141383) has role EC 4.1.1.15 (glutamate decarboxylase) inhibitor (CHEBI:142581) |
| 4,5-dihydroxyisophthalic acid (CHEBI:141383) is a catechols (CHEBI:33566) |
| 4,5-dihydroxyisophthalic acid (CHEBI:141383) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Names |
|---|
| 4,5-dihydroxyisophthalic acid |
| 4,5-dihydroxybenzene-1,3-dicarboxylic acid |
| Citations |
|---|