EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H13NO7 |
| Net Charge | 0 |
| Average Mass | 367.313 |
| Monoisotopic Mass | 367.06920 |
| SMILES | NC(=O)CC1OC(=O)Cc2cc3c(c(O)c21)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C19H13NO7/c20-12(22)6-11-14-7(5-13(23)27-11)4-9-16(18(14)25)19(26)15-8(17(9)24)2-1-3-10(15)21/h1-4,11,21,25H,5-6H2,(H2,20,22) |
| InChIKey | QZENCFIHIPLZMU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces aureofaciens (ncbitaxon:1894) | - | PubMed (101502) | Strain: various |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ekatetrone (CHEBI:141382) has role antineoplastic agent (CHEBI:35610) |
| ekatetrone (CHEBI:141382) has role bacterial metabolite (CHEBI:76969) |
| ekatetrone (CHEBI:141382) is a anthraquinone (CHEBI:22580) |
| ekatetrone (CHEBI:141382) is a organic heterotetracyclic compound (CHEBI:38163) |
| ekatetrone (CHEBI:141382) is a phenols (CHEBI:33853) |
| ekatetrone (CHEBI:141382) is a primary carboxamide (CHEBI:140324) |
| ekatetrone (CHEBI:141382) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (+)-2-(10,12-dihydroxy-3,6,11-trioxo-3,4,6,11-tetrahydro-1H-naphtho[2,3-g]isochromen-1-yl)acetamide |
| Synonyms | Source |
|---|---|
| 1,8-dihydroxy-2-(1'-hydroxy-2'-carbamoyl)ethyl-9,10-anthraquinone-3-acetic acid lactone | ChEBI |
| (+)-3,4,6,11-tetrahydro-10,12-dihydroxy-3,6,11-trioxo-1H-anthra[2,3-c]pyran-1-acetamide | ChEBI |
| ekatetron | ChEBI |
| (+)-ekatetrone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00018198 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:12794-19-3 | ChEBI |
| Citations |
|---|