EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H43NO4 |
| Net Charge | 0 |
| Average Mass | 493.688 |
| Monoisotopic Mass | 493.31921 |
| SMILES | [H][C@@]12CC[C@H](CC)[C@@]1([H])C=C[C@@]([H])(/C=C/C=C(\CC)[C@]1([H])O[C@@]([H])([C@@H](C)C(=O)O)CC[C@@H]1C)[C@@]2([H])C(=O)c1cccn1 |
| InChI | InChI=1S/C31H43NO4/c1-5-21-13-16-25-24(21)15-14-23(28(25)29(33)26-11-8-18-32-26)10-7-9-22(6-2)30-19(3)12-17-27(36-30)20(4)31(34)35/h7-11,14-15,18-21,23-25,27-28,30,32H,5-6,12-13,16-17H2,1-4H3,(H,34,35)/b10-7+,22-9+/t19-,20+,21-,23+,24+,25+,27+,28+,30+/m0/s1 |
| InChIKey | BAIPOTOKPGDCHA-MWBHXQFBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces antibioticus (ncbitaxon:1890) | - | PubMed (374323) | Strain: NRRL 8167 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. ionophore A compound which can carry specific ions through membranes of cells or organelles. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. animal growth promotant Substances that are administered to farmed animals to improve productivity by promoting weight gain, increasing muscle mass, limiting fat deposition, reducing feed consumption, and reducing waste production. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indanomycin (CHEBI:141380) has role animal growth promotant (CHEBI:82655) |
| indanomycin (CHEBI:141380) has role antibacterial agent (CHEBI:33282) |
| indanomycin (CHEBI:141380) has role antihypertensive agent (CHEBI:35674) |
| indanomycin (CHEBI:141380) has role antineoplastic agent (CHEBI:35610) |
| indanomycin (CHEBI:141380) has role bacterial metabolite (CHEBI:76969) |
| indanomycin (CHEBI:141380) has role insecticide (CHEBI:24852) |
| indanomycin (CHEBI:141380) has role ionophore (CHEBI:24869) |
| indanomycin (CHEBI:141380) is a aromatic ketone (CHEBI:76224) |
| indanomycin (CHEBI:141380) is a indene (CHEBI:37910) |
| indanomycin (CHEBI:141380) is a monocarboxylic acid (CHEBI:25384) |
| indanomycin (CHEBI:141380) is a oxanes (CHEBI:46942) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,5S,6R)-6-{(3E,5E)-6-[(1S,3aR,4S,5S,7aS)-1-ethyl-4-(1H-pyrrol-2-ylcarbonyl)-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]hexa-3,5-dien-3-yl}-5-methyltetrahydro-2H-pyran-2-yl]propanoic acid |
| Synonyms | Source |
|---|---|
| antibiotic X 14547A | KNApSAcK |
| (−)-X-14547A | ChEBI |
| X-14547A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00016347 | KNApSAcK |
| Citations |
|---|