EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H65NO14 |
| Net Charge | 0 |
| Average Mass | 771.942 |
| Monoisotopic Mass | 771.44051 |
| SMILES | CC[C@H]1OC(=O)C[C@@H](O)[C@H](C)[C@@H](O[C@H]2C[C@@H](N(C)C)[C@H](O)[C@@H](C)O2)[C@@H](CC=O)C[C@@H](C)C(=O)/C=C/C2(C)OC2[C@@H]1CO[C@@H]1O[C@H](C)[C@@H](O)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C39H65NO14/c1-11-29-25(19-49-38-36(48-10)35(47-9)33(46)23(5)51-38)37-39(6,54-37)14-12-27(42)20(2)16-24(13-15-41)34(21(3)28(43)18-30(44)52-29)53-31-17-26(40(7)8)32(45)22(4)50-31/h12,14-15,20-26,28-29,31-38,43,45-46H,11,13,16-19H2,1-10H3/b14-12+/t20-,21+,22-,23-,24+,25-,26-,28-,29-,31+,32-,33-,34-,35-,36-,37?,38-,39?/m1/s1 |
| InChIKey | LKWYVXHWASIBBX-PFXKZVKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (541251) | Strain: AS-NG 16 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| staphcoccomycin (CHEBI:141378) has role bacterial metabolite (CHEBI:76969) |
| staphcoccomycin (CHEBI:141378) is a macrolide antibiotic (CHEBI:25105) |
| staphcoccomycin (CHEBI:141378) is a monosaccharide derivative (CHEBI:63367) |
| Manual Xrefs | Databases |
|---|---|
| 6444207 | PubChem Compound |
| Citations |
|---|