EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H58O7 |
| Net Charge | 0 |
| Average Mass | 566.820 |
| Monoisotopic Mass | 566.41825 |
| SMILES | [H][C@]1([C@@H](C)[C@@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O)CC/C=C/[C@@H](C)[C@@H](O)/C(C)=C/[C@H](C)CC=C)O[C@]([H])([C@H](C)C(=O)O)CC[C@@H]1C |
| InChI | InChI=1S/C33H58O7/c1-10-13-19(2)18-22(5)29(35)20(3)14-11-12-15-27(34)23(6)30(36)25(8)31(37)26(9)32-21(4)16-17-28(40-32)24(7)33(38)39/h10-11,14,18-21,23-32,34-37H,1,12-13,15-17H2,2-9H3,(H,38,39)/b14-11+,22-18+/t19-,20-,21+,23+,24+,25+,26+,27-,28+,29-,30+,31+,32+/m1/s1 |
| InChIKey | CHYQBJKLYBRPQK-FXLACHKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (2759903) | Strain: N731-45 |
| Roles Classification |
|---|
| Biological Roles: | ionophore A compound which can carry specific ions through membranes of cells or organelles. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-dehydrozincophorin (CHEBI:141374) has role bacterial metabolite (CHEBI:76969) |
| 24-dehydrozincophorin (CHEBI:141374) has role ionophore (CHEBI:24869) |
| 24-dehydrozincophorin (CHEBI:141374) is a pyrans (CHEBI:26407) |
| Synonym | Source |
|---|---|
| CP-78,545 | SUBMITTER |
| Citations |
|---|