EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H48O7 |
| Net Charge | 0 |
| Average Mass | 556.740 |
| Monoisotopic Mass | 556.34000 |
| SMILES | [H][C@@]12C/C=C(\C)C[C@@H](C)/C=C/C=C3\CO[C@]4([H])[C@H](O)C(C)=C[C@@]([H])(C(=O)O[C@@H](C1)C[C@]1(CC[C@H](C)[C@@H](C(C)C)O1)O2)[C@]34O |
| InChI | InChI=1S/C33H48O7/c1-19(2)29-22(5)12-13-32(40-29)17-26-16-25(39-32)11-10-21(4)14-20(3)8-7-9-24-18-37-30-28(34)23(6)15-27(31(35)38-26)33(24,30)36/h7-10,15,19-20,22,25-30,34,36H,11-14,16-18H2,1-6H3/b8-7+,21-10+,24-9+/t20-,22-,25+,26-,27-,28+,29+,30+,32+,33+/m0/s1 |
| InChIKey | BWCRYQGQPDBOAU-WZBVPYLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (2211369) | Strain: E225 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). anthelminthic drug Substance intended to kill parasitic worms (helminths). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milbemycin D (CHEBI:141371) has role anthelminthic drug (CHEBI:35443) |
| milbemycin D (CHEBI:141371) has role insecticide (CHEBI:24852) |
| milbemycin D (CHEBI:141371) has role nematicide (CHEBI:25491) |
| milbemycin D (CHEBI:141371) is a milbemycin (CHEBI:50345) |
| IUPAC Name |
|---|
| (2aE,4E,5'S,6R,6'R,8E,11R,13R,15S,17aR,20R,20aR,20bS)-20,20b-dihydroxy-6'-isopropyl-5',6,8,19-tetramethyl-3',4',5',6,6',7,10,11,14,15,17a,20,20a,20b-tetradecahydro-2H,17H-spiro[11,15-methanofuro[4,3,2-pq][2,6]benzodioxacyclooctadecine-13,2'-pyran]-17-one |
| Synonyms | Source |
|---|---|
| 5-O-demethyl-28-deoxy-6R,28-epoxy-25R-(1-methylethyl)-milbemycin B | ChEBI |
| (6R,25R)-5-O-demethyl-28-deoxy-6,28-epoxy-25-(1-methylethyl)milbemycin B | ChemIDplus |
| antibiotic B 41D | ChemIDplus |
| B 41D | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:77855-81-3 | ChemIDplus |
| Citations |
|---|