EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H48O7 |
| Net Charge | 0 |
| Average Mass | 556.740 |
| Monoisotopic Mass | 556.34000 |
| SMILES | [H][C@@]12C/C=C(\C)C[C@@H](C)/C=C/C=C3\CO[C@]4([H])[C@H](O)C(C)=C[C@@]([H])(C(=O)O[C@@H](C1)C[C@]1(CC[C@H](C)[C@@H](C(C)C)O1)O2)[C@]34O |
| InChI | InChI=1S/C33H48O7/c1-19(2)29-22(5)12-13-32(40-29)17-26-16-25(39-32)11-10-21(4)14-20(3)8-7-9-24-18-37-30-28(34)23(6)15-27(31(35)38-26)33(24,30)36/h7-10,15,19-20,22,25-30,34,36H,11-14,16-18H2,1-6H3/b8-7+,21-10+,24-9+/t20-,22-,25+,26-,27-,28+,29+,30+,32+,33+/m0/s1 |
| InChIKey | BWCRYQGQPDBOAU-WZBVPYLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (2211369) | Strain: E225 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Applications: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| milbemycin D (CHEBI:141371) has role anthelminthic drug (CHEBI:35443) |
| milbemycin D (CHEBI:141371) has role insecticide (CHEBI:24852) |
| milbemycin D (CHEBI:141371) has role nematicide (CHEBI:25491) |
| milbemycin D (CHEBI:141371) is a milbemycin (CHEBI:50345) |
| IUPAC Name |
|---|
| (2aE,4E,5'S,6R,6'R,8E,11R,13R,15S,17aR,20R,20aR,20bS)-20,20b-dihydroxy-6'-isopropyl-5',6,8,19-tetramethyl-3',4',5',6,6',7,10,11,14,15,17a,20,20a,20b-tetradecahydro-2H,17H-spiro[11,15-methanofuro[4,3,2-pq][2,6]benzodioxacyclooctadecine-13,2'-pyran]-17-one |
| Synonyms | Source |
|---|---|
| 5-O-demethyl-28-deoxy-6R,28-epoxy-25R-(1-methylethyl)-milbemycin B | ChEBI |
| (6R,25R)-5-O-demethyl-28-deoxy-6,28-epoxy-25-(1-methylethyl)milbemycin B | ChemIDplus |
| antibiotic B 41D | ChemIDplus |
| B 41D | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:77855-81-3 | ChemIDplus |
| Citations |
|---|