EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O2 |
| Net Charge | 0 |
| Average Mass | 456.755 |
| Monoisotopic Mass | 456.39673 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)C/C=C/C(C)(C)OC)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C31H52O2/c1-21(11-10-17-27(2,3)33-9)22-14-19-31(8)24-12-13-25-28(4,5)26(32)16-18-29(25,6)23(24)15-20-30(22,31)7/h10,17,21-22,25-26,32H,11-16,18-20H2,1-9H3/b17-10+/t21-,22-,25+,26+,29-,30-,31+/m1/s1 |
| InChIKey | KMUGSJNEBPVLKO-PWUQRKGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scleroderma sp. UFSMSc1 (ncbitaxon:436453) | - | PubMed (26826733) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sclerodol B (CHEBI:141365) has parent hydride lanostane (CHEBI:20265) |
| sclerodol B (CHEBI:141365) has role antifungal agent (CHEBI:35718) |
| sclerodol B (CHEBI:141365) has role fungal metabolite (CHEBI:76946) |
| sclerodol B (CHEBI:141365) is a 3β-hydroxy steroid (CHEBI:36836) |
| sclerodol B (CHEBI:141365) is a ether (CHEBI:25698) |
| sclerodol B (CHEBI:141365) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3β,23E)-25-methoxylanosta-8,23-dien-3-ol |
| Synonym | Source |
|---|---|
| sclerodol B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29689270 | Reaxys |
| Citations |
|---|