EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26O5 |
| Net Charge | 0 |
| Average Mass | 298.379 |
| Monoisotopic Mass | 298.17802 |
| SMILES | CCCCCCC[C@H]1OC2=C(C(=O)O[C@@H]2C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C16H26O5/c1-4-5-6-7-8-9-11-16(3,19)14(17)12-13(21-11)10(2)20-15(12)18/h10-11,14,17,19H,4-9H2,1-3H3/t10-,11-,14-,16-/m1/s1 |
| InChIKey | VVQFDQXQOOFTTF-MMYVAXCBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phaeoacremonium sp. (ncbitaxon:1769363) | - | PubMed (28425292) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoaigialone B (CHEBI:141363) has role antifungal agent (CHEBI:35718) |
| isoaigialone B (CHEBI:141363) has role fungal metabolite (CHEBI:76946) |
| isoaigialone B (CHEBI:141363) is a diol (CHEBI:23824) |
| isoaigialone B (CHEBI:141363) is a organic heterobicyclic compound (CHEBI:27171) |
| isoaigialone B (CHEBI:141363) is a secondary alcohol (CHEBI:35681) |
| isoaigialone B (CHEBI:141363) is a tertiary alcohol (CHEBI:26878) |
| isoaigialone B (CHEBI:141363) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2R,3S,4R,7R)-2-heptyl-3,4-dihydroxy-3,7-dimethyl-2,3,4,7-tetrahydro-5H-furo[3,4-b]pyran-5-one |
| Citations |
|---|