EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141361 - aigialone
| ChEBI ID | CHEBI:141361 |
| ChEBI Name | aigialone |
| Stars | |
| Definition | A furopyran that is 5,6-dihydro-4H-furo[2,3-b]pyran-3(2H)-one which is substituted by hydroxy groups at positions 4 and 5, methyl groups at positions 2 and 5, and a heptyl group at position 6 (the 2R,4R,5S,6R stereoisomer). Isolated from the mangrove fungus Aigialus parvus BCC 5311 and from Phaeoacremonium sp., an endophytic fungus from Senna spectabilis. |
| Last Modified | 8 November 2024 |
| Submitter | R. Stephan |
| Downloads |
| Formula | C16H26O5 |
| Net Charge | 0 |
| Average Mass | 298.379 |
| Monoisotopic Mass | 298.17802 |
| SMILES | CCCCCCC[C@H]1OC2=C(C(=O)[C@@H](C)O2)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C16H26O5/c1-4-5-6-7-8-9-11-16(3,19)14(18)12-13(17)10(2)20-15(12)21-11/h10-11,14,18-19H,4-9H2,1-3H3/t10-,11-,14-,16-/m1/s1 |
| InChIKey | YVCGKKHYXVEPMA-MMYVAXCBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phaeoacremonium sp. (ncbitaxon:1769363) | - | PubMed (28425292 ) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aigialone (CHEBI:141361) has role antifungal agent (CHEBI:35718) |
| aigialone (CHEBI:141361) has role fungal metabolite (CHEBI:76946) |
| aigialone (CHEBI:141361) is a cyclic ketone (CHEBI:3992) |
| aigialone (CHEBI:141361) is a furopyran (CHEBI:74927) |
| aigialone (CHEBI:141361) is a ketene acetal (CHEBI:145408) |
| aigialone (CHEBI:141361) is a secondary alcohol (CHEBI:35681) |
| aigialone (CHEBI:141361) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2R,4R,5S,6R)-6-heptyl-4,5-dihydroxy-2,5-dimethyl-5,6-dihydro-4H-furo[2,3-b]pyran-3(2H)-one |
| Synonym | Source |
|---|---|
| (−)-aigialone | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00043254 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:666735-72-4 | KNApSAcK |
| Citations |
|---|