EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141360 - helvolic acid methyl ester
| ChEBI ID | CHEBI:141360 |
| ChEBI Name | helvolic acid methyl ester |
| Stars | |
| Definition | A methyl ester resulting from the formal condensation of the carboxy group of helvolic acid with methanol. Isolated from the fermentation of endophytic fungus Fusarium sp. in Ficus carica leaves. |
| Last Modified | 18 November 2019 |
| Submitter | R. Stephan |
| Downloads |
| Formula | C34H46O8 |
| Net Charge | 0 |
| Average Mass | 582.734 |
| Monoisotopic Mass | 582.31927 |
| SMILES | [H][C@]12[C@H](C)C(=O)C=C[C@]1(C)[C@]1([H])CC[C@@]3([H])/C(=C(\CCC=C(C)C)C(=O)OC)[C@@H](OC(C)=O)C[C@]3(C)[C@@]1(C)C(=O)[C@H]2OC(C)=O |
| InChI | InChI=1S/C34H46O8/c1-18(2)11-10-12-22(31(39)40-9)27-23-13-14-26-32(6)16-15-24(37)19(3)28(32)29(42-21(5)36)30(38)34(26,8)33(23,7)17-25(27)41-20(4)35/h11,15-16,19,23,25-26,28-29H,10,12-14,17H2,1-9H3/b27-22-/t19-,23+,25+,26+,28-,29+,32-,33+,34-/m1/s1 |
| InChIKey | JHEAWXMXAWIRAB-FTVOIDONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium sp. | - | PubMed (27265219) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| helvolic acid methyl ester (CHEBI:141360) has functional parent helvolic acid (CHEBI:62460) |
| helvolic acid methyl ester (CHEBI:141360) has role antibacterial agent (CHEBI:33282) |
| helvolic acid methyl ester (CHEBI:141360) has role antifungal agent (CHEBI:35718) |
| helvolic acid methyl ester (CHEBI:141360) has role fungal metabolite (CHEBI:76946) |
| helvolic acid methyl ester (CHEBI:141360) is a 3-oxo-Δ1 steroid (CHEBI:20156) |
| helvolic acid methyl ester (CHEBI:141360) is a acetate ester (CHEBI:47622) |
| helvolic acid methyl ester (CHEBI:141360) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl (17Z)-6β,16β-diacetoxy-4α,8,14-trimethyl-3,7-dioxo-5α,8α,9β,13α,14β-18-norcholesta-1,17,24-trien-21-oate |
| Synonyms | Source |
|---|---|
| methyl (4α,6β,8α,9β,13α,14β,16β,17Z)-6,16-bis(acetyloxy)-3,7-dioxo-29-nordammara-1,17(20),24-trien-21-oate | ChEBI |
| methyl helvolate | ChEBI |
| Citations |
|---|