EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141360 - helvolic acid methyl ester
| ChEBI ID | CHEBI:141360 |
| ChEBI Name | helvolic acid methyl ester |
| Stars | |
| Definition | A methyl ester resulting from the formal condensation of the carboxy group of helvolic acid with methanol. Isolated from the fermentation of endophytic fungus Fusarium sp. in Ficus carica leaves. |
| Last Modified | 18 November 2019 |
| Submitter | R. Stephan |
| Downloads |
| Formula | C34H46O8 |
| Net Charge | 0 |
| Average Mass | 582.734 |
| Monoisotopic Mass | 582.31927 |
| SMILES | [H][C@]12[C@H](C)C(=O)C=C[C@]1(C)[C@]1([H])CC[C@@]3([H])/C(=C(\CCC=C(C)C)C(=O)OC)[C@@H](OC(C)=O)C[C@]3(C)[C@@]1(C)C(=O)[C@H]2OC(C)=O |
| InChI | InChI=1S/C34H46O8/c1-18(2)11-10-12-22(31(39)40-9)27-23-13-14-26-32(6)16-15-24(37)19(3)28(32)29(42-21(5)36)30(38)34(26,8)33(23,7)17-25(27)41-20(4)35/h11,15-16,19,23,25-26,28-29H,10,12-14,17H2,1-9H3/b27-22-/t19-,23+,25+,26+,28-,29+,32-,33+,34-/m1/s1 |
| InChIKey | JHEAWXMXAWIRAB-FTVOIDONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium sp. | - | PubMed (27265219) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| helvolic acid methyl ester (CHEBI:141360) has functional parent helvolic acid (CHEBI:62460) |
| helvolic acid methyl ester (CHEBI:141360) has role antibacterial agent (CHEBI:33282) |
| helvolic acid methyl ester (CHEBI:141360) has role antifungal agent (CHEBI:35718) |
| helvolic acid methyl ester (CHEBI:141360) has role fungal metabolite (CHEBI:76946) |
| helvolic acid methyl ester (CHEBI:141360) is a 3-oxo-Δ1 steroid (CHEBI:20156) |
| helvolic acid methyl ester (CHEBI:141360) is a acetate ester (CHEBI:47622) |
| helvolic acid methyl ester (CHEBI:141360) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl (17Z)-6β,16β-diacetoxy-4α,8,14-trimethyl-3,7-dioxo-5α,8α,9β,13α,14β-18-norcholesta-1,17,24-trien-21-oate |
| Synonyms | Source |
|---|---|
| methyl (4α,6β,8α,9β,13α,14β,16β,17Z)-6,16-bis(acetyloxy)-3,7-dioxo-29-nordammara-1,17(20),24-trien-21-oate | ChEBI |
| methyl helvolate | ChEBI |
| Citations |
|---|