EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N3O3S |
| Net Charge | 0 |
| Average Mass | 297.380 |
| Monoisotopic Mass | 297.11471 |
| SMILES | C[C@@H](N)C(=O)Nc1ccccc1C(=O)N[C@@H](O)CCS |
| InChI | InChI=1S/C13H19N3O3S/c1-8(14)12(18)15-10-5-3-2-4-9(10)13(19)16-11(17)6-7-20/h2-5,8,11,17,20H,6-7,14H2,1H3,(H,15,18)(H,16,19)/t8-,11+/m1/s1 |
| InChIKey | DQGIXJCPVVNGMY-KCJUWKMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium chlamydosporum (ncbitaxon:86545) | - | PubMed (27634222) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fusarithioamide A (CHEBI:141359) has functional parent D-alanine (CHEBI:15570) |
| fusarithioamide A (CHEBI:141359) has role antifungal agent (CHEBI:35718) |
| fusarithioamide A (CHEBI:141359) has role antineoplastic agent (CHEBI:35610) |
| fusarithioamide A (CHEBI:141359) has role fungal metabolite (CHEBI:76946) |
| fusarithioamide A (CHEBI:141359) is a benzamides (CHEBI:22702) |
| fusarithioamide A (CHEBI:141359) is a organic hydroxy compound (CHEBI:33822) |
| fusarithioamide A (CHEBI:141359) is a primary amino compound (CHEBI:50994) |
| fusarithioamide A (CHEBI:141359) is a secondary carboxamide (CHEBI:140325) |
| fusarithioamide A (CHEBI:141359) is a thiol (CHEBI:29256) |
| IUPAC Names |
|---|
| 2-(D-alanylamino)-N-[(1S)-1-hydroxy-3-mercaptopropyl]benzamide |
| 2-(D-alanylamino)-N-[(1S)-1-hydroxy-3-sulfanylpropyl]benzamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30208318 | Reaxys |
| Citations |
|---|