EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N3O3S |
| Net Charge | 0 |
| Average Mass | 297.380 |
| Monoisotopic Mass | 297.11471 |
| SMILES | C[C@@H](N)C(=O)Nc1ccccc1C(=O)N[C@@H](O)CCS |
| InChI | InChI=1S/C13H19N3O3S/c1-8(14)12(18)15-10-5-3-2-4-9(10)13(19)16-11(17)6-7-20/h2-5,8,11,17,20H,6-7,14H2,1H3,(H,15,18)(H,16,19)/t8-,11+/m1/s1 |
| InChIKey | DQGIXJCPVVNGMY-KCJUWKMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium chlamydosporum (ncbitaxon:86545) | - | PubMed (27634222) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fusarithioamide A (CHEBI:141359) has functional parent D-alanine (CHEBI:15570) |
| fusarithioamide A (CHEBI:141359) has role antifungal agent (CHEBI:35718) |
| fusarithioamide A (CHEBI:141359) has role antineoplastic agent (CHEBI:35610) |
| fusarithioamide A (CHEBI:141359) has role fungal metabolite (CHEBI:76946) |
| fusarithioamide A (CHEBI:141359) is a benzamides (CHEBI:22702) |
| fusarithioamide A (CHEBI:141359) is a organic hydroxy compound (CHEBI:33822) |
| fusarithioamide A (CHEBI:141359) is a primary amino compound (CHEBI:50994) |
| fusarithioamide A (CHEBI:141359) is a secondary carboxamide (CHEBI:140325) |
| fusarithioamide A (CHEBI:141359) is a thiol (CHEBI:29256) |
| IUPAC Names |
|---|
| 2-(D-alanylamino)-N-[(1S)-1-hydroxy-3-mercaptopropyl]benzamide |
| 2-(D-alanylamino)-N-[(1S)-1-hydroxy-3-sulfanylpropyl]benzamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30208318 | Reaxys |
| Citations |
|---|