EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H75N7O11 |
| Net Charge | 0 |
| Average Mass | 902.144 |
| Monoisotopic Mass | 901.55246 |
| SMILES | CCCCCCCCCCC[C@H](C)[C@@H]1CC(=O)NC([C@H](C)O)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H](Cc2ccc(O)cc2)C(=O)N[C@H]([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C46H75N7O11/c1-8-10-11-12-13-14-15-16-17-18-28(4)36-26-38(57)52-40(31(7)54)45(62)49-29(5)41(58)48-30(6)42(59)50-34(23-24-37(47)56)43(60)51-35(25-32-19-21-33(55)22-20-32)44(61)53-39(27(3)9-2)46(63)64-36/h19-22,27-31,34-36,39-40,54-55H,8-18,23-26H2,1-7H3,(H2,47,56)(H,48,58)(H,49,62)(H,50,59)(H,51,60)(H,52,57)(H,53,61)/t27-,28-,29+,30+,31-,34+,35+,36-,39+,40?/m0/s1 |
| InChIKey | ACZADZDITGHQQJ-AUTDNOAOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium sp. (ncbitaxon:29916) | - | PubMed (28446036) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fusaripeptide A (CHEBI:141356) has role antifungal agent (CHEBI:35718) |
| fusaripeptide A (CHEBI:141356) has role fungal metabolite (CHEBI:76946) |
| fusaripeptide A (CHEBI:141356) is a heterodetic cyclic peptide (CHEBI:24533) |
| Citations |
|---|