EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO3 |
| Net Charge | 0 |
| Average Mass | 267.284 |
| Monoisotopic Mass | 267.08954 |
| SMILES | COc1ccc(O)c2c(-c3ccccc3)cnc(=O)c12 |
| InChI | InChI=1S/C16H13NO3/c1-20-13-8-7-12(18)14-11(9-17-16(19)15(13)14)10-5-3-2-4-6-10/h2-9,18H,1H3,(H,17,19) |
| InChIKey | ZOITXTLCKPXXHV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium sp. R22 (ncbitaxon:1856372) | - | PubMed (27910702) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxy-8-methoxy-4-phenylisoquinolin-1(2H)-one (CHEBI:141354) has role antifungal agent (CHEBI:35718) |
| 5-hydroxy-8-methoxy-4-phenylisoquinolin-1(2H)-one (CHEBI:141354) has role fungal metabolite (CHEBI:76946) |
| 5-hydroxy-8-methoxy-4-phenylisoquinolin-1(2H)-one (CHEBI:141354) is a aromatic ether (CHEBI:35618) |
| 5-hydroxy-8-methoxy-4-phenylisoquinolin-1(2H)-one (CHEBI:141354) is a isoquinolinol (CHEBI:24923) |
| IUPAC Names |
|---|
| 5-hydroxy-8-methoxy-4-phenylisoquinolin-1(2H)-one |
| 8-methoxy-4-phenylisoquinoline-1,5-diol |
| Synonym | Source |
|---|---|
| 5-hydroxy-8-methoxy-4-phenyl-2H-isoquinolin-1-one | ChEBI |
| Citations |
|---|