EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23ClN2O3 |
| Net Charge | 0 |
| Average Mass | 410.901 |
| Monoisotopic Mass | 410.13972 |
| SMILES | O=C(O)c1cccc(-c2cccc(NCCNC[C@H](O)c3cccc(Cl)c3)c2)c1 |
| InChI | InChI=1S/C23H23ClN2O3/c24-20-8-2-6-18(13-20)22(27)15-25-10-11-26-21-9-3-5-17(14-21)16-4-1-7-19(12-16)23(28)29/h1-9,12-14,22,25-27H,10-11,15H2,(H,28,29)/t22-/m0/s1 |
| InChIKey | LLDXOPKUNJTIRF-QFIPXVFZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| Application: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| solabegron (CHEBI:141346) has role β-adrenergic agonist (CHEBI:35522) |
| solabegron (CHEBI:141346) is a carboxybiphenyl (CHEBI:141493) |
| solabegron (CHEBI:141346) is a monochlorobenzenes (CHEBI:83403) |
| solabegron (CHEBI:141346) is a secondary alcohol (CHEBI:35681) |
| solabegron (CHEBI:141346) is a secondary amino compound (CHEBI:50995) |
| solabegron (CHEBI:141346) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 3'-[(2-{[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino}ethyl)amino][biphenyl]-3-carboxylic acid |
| INNs | Source |
|---|---|
| solabegron | WHO MedNet |
| solabegrón | WHO MedNet |
| solabégron | WHO MedNet |
| solabegronum | WHO MedNet |
| Synonyms | Source |
|---|---|
| GW 427353 | ChEBI |
| GW-427353 | ChEBI |
| GW427353 | ChEBI |
| (R)-3'-((2-((2-(3-chlorophenyl)-2-hydroxyethyl)amino)ethyl)amino)-(1,1'-biphenyl)-3-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| DB06190 | DrugBank |
| Solabegron | Wikipedia |
| US8642661 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10484931 | Reaxys |
| CAS:252920-94-8 | ChemIDplus |
| Citations |
|---|