EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO |
| Net Charge | 0 |
| Average Mass | 85.106 |
| Monoisotopic Mass | 85.05276 |
| SMILES | C[C@@H](O)CC#N |
| InChI | InChI=1S/C4H7NO/c1-4(6)2-3-5/h4,6H,2H2,1H3/t4-/m1/s1 |
| InChIKey | BYJAJQGCMSBKPB-SCSAIBSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sp. (ncbitaxon:5065) | - | PubMed (24708541) | Strain: KJ-9 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-hydroxybutanenitrile (CHEBI:141345) has role antifungal agent (CHEBI:35718) |
| (R)-3-hydroxybutanenitrile (CHEBI:141345) has role fungal metabolite (CHEBI:76946) |
| (R)-3-hydroxybutanenitrile (CHEBI:141345) is a 3-hydroxybutanenitrile (CHEBI:142961) |
| IUPAC Name |
|---|
| (3R)-3-hydroxybutanenitrile |
| Synonyms | Source |
|---|---|
| (−)-3-hydroxybutyronitrile | ChEBI |
| (3R)-3-hydroxybutyronitrile | ChEBI |
| (R)-3-hydroxybutanonitrile | ChEBI |
| (R)-(−)-3-hydroxybutyronitrile | ChEBI |
| (R)-3-hydroxybutyronitrile | ChEBI |
| (R)-β-hydroxybutyronitrile | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:125103-95-9 | PubChem Compound |
| Citations |
|---|