EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16Cl2O7 |
| Net Charge | 0 |
| Average Mass | 391.203 |
| Monoisotopic Mass | 390.02731 |
| SMILES | COC1=CC2C=C(CC3(C(Cl)Cl)C[C@H](O)C(=O)O3)OC(=O)C2C(O)=C1 |
| InChI | InChI=1S/C16H16Cl2O7/c1-23-8-2-7-3-9(24-14(22)12(7)10(19)4-8)5-16(15(17)18)6-11(20)13(21)25-16/h2-4,7,11-12,15,19-20H,5-6H2,1H3/t7?,11-,12?,16?/m0/s1 |
| InChIKey | VGDCFUPJKMVWMA-IHYLGMPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichoderma sp. (ncbitaxon:1715253) | - | PubMed (27867266) | Strain: 09 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichlorodiaportinolide (CHEBI:141344) has role antifungal agent (CHEBI:35718) |
| dichlorodiaportinolide (CHEBI:141344) has role fungal metabolite (CHEBI:76946) |
| dichlorodiaportinolide (CHEBI:141344) is a isocoumarins (CHEBI:38758) |
| Citations |
|---|