EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6O3 |
| Net Charge | 0 |
| Average Mass | 150.133 |
| Monoisotopic Mass | 150.03169 |
| SMILES | O=C1Cc2cc(O)ccc2O1 |
| InChI | InChI=1S/C8H6O3/c9-6-1-2-7-5(3-6)4-8(10)11-7/h1-3,9H,4H2 |
| InChIKey | POUITAHNNRJWMA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium sp. (ncbitaxon:29916) | - | PubMed (27598120) | Strain: WF5 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxybenzofuran-2-one (CHEBI:141343) has role antifungal agent (CHEBI:35718) |
| 5-hydroxybenzofuran-2-one (CHEBI:141343) has role fungal metabolite (CHEBI:76946) |
| 5-hydroxybenzofuran-2-one (CHEBI:141343) is a 1-benzofurans (CHEBI:38830) |
| 5-hydroxybenzofuran-2-one (CHEBI:141343) is a aromatic alcohol (CHEBI:33854) |
| IUPAC Name |
|---|
| 5-hydroxy-1-benzofuran-2(3H)-one |
| Synonyms | Source |
|---|---|
| 2,3-dihydro-5-hydroxybenzofuran-2-one | ChEBI |
| 5-hydroxy-2(3H)-benzofuranone | ChEBI |
| 5-hydroxy-2-coumaranone | ChEBI |
| homogentisic acid γ-lactone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:128621 | Reaxys |
| CAS:2688-48-4 | ChemIDplus |
| Citations |
|---|