EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141340 - altenusin
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | COc1cc(O)c(C(=O)O)c(-c2cc(O)c(O)cc2C)c1 |
| InChI | InChI=1S/C15H14O6/c1-7-3-11(16)12(17)6-9(7)10-4-8(21-2)5-13(18)14(10)15(19)20/h3-6,16-18H,1-2H3,(H,19,20) |
| InChIKey | ADPBTBPPIIKLEH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria alternata (ncbitaxon:5599) | - | PubMed (24385360) | |
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (28067492) | Strain: CVAL4 |
| Alternaria sp. (ncbitaxon:1715220) | |||
| - | PubMed (28300771) | Strain: NH-F6 | |
| - | Article (Xu, X., Zhao, S., Wei, J., Fang, N., Yin, L. and Sun, J. (2012) Porric acid D from marine-derived fungus Alternaria sp. isolated from Bohai Sea. Chem, Nat. Compd., 47(6), 893-895.) | ||
| - | PubMed (19835393) | ||
| Didymella glomerata (ncbitaxon:749621) | - | PubMed (27450949) | |
| Botryosphaeria dothidea (ncbitaxon:55169) | - | PubMed (24689437) | Strain: KJ-1 |
| Talaromyces flavus (ncbitaxon:5095) | - | Article (Ayer, W.A. and Racok, J.S. (1990) The metabolites of Talaromycesflavus: part 1. metabolites of the organic extracts. Can. J. Chem., 68(11), 2085-2094.) | |
| Alternaria kikuchiana (ncbitaxon:1232598) | - | PubMed (Kameda, K., Aoki, H., Namiki, M. and Overeem, J.C. (1974) An alternative structure for botrallin a metabolite of botrytis allii. Tetrahedron Lett., 15(1), 103-106.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| altenusin (CHEBI:141340) has role antifungal agent (CHEBI:35718) |
| altenusin (CHEBI:141340) has role fungal metabolite (CHEBI:76946) |
| altenusin (CHEBI:141340) is a aromatic ether (CHEBI:35618) |
| altenusin (CHEBI:141340) is a carboxybiphenyl (CHEBI:141493) |
| altenusin (CHEBI:141340) is a catechols (CHEBI:33566) |
| altenusin (CHEBI:141340) is a hydroxybiphenyls (CHEBI:24681) |
| altenusin (CHEBI:141340) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3,4',5'-trihydroxy-5-methoxy-2'-methyl[biphenyl]-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-(4,5-dihydroxy-2-methylphenyl)-6-hydroxy-4-methoxybenzoic acid | ChEBI |
| altenusin | ChemIDplus |
| 2,4',5'-trihydroxy-5-methoxy-2'-methyl-(1,1'-biphenyl)-2-carboxylic acid | ChemIDplus |
| alutenusin | ChemIDplus |
| MS-341 | ChEBI |
| MS 341 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00023666 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2223336 | Reaxys |
| CAS:31186-12-6 | ChemIDplus |
| Citations |
|---|