EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141340 - altenusin
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | COc1cc(O)c(C(=O)O)c(-c2cc(O)c(O)cc2C)c1 |
| InChI | InChI=1S/C15H14O6/c1-7-3-11(16)12(17)6-9(7)10-4-8(21-2)5-13(18)14(10)15(19)20/h3-6,16-18H,1-2H3,(H,19,20) |
| InChIKey | ADPBTBPPIIKLEH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria alternata (ncbitaxon:5599) | - | PubMed (24385360) | |
| Alternaria kikuchiana (ncbitaxon:1232598) | - | PubMed (Kameda, K., Aoki, H., Namiki, M. and Overeem, J.C. (1974) An alternative structure for botrallin a metabolite of botrytis allii. Tetrahedron Lett., 15(1), 103-106.) | |
| Alternaria sp. (ncbitaxon:1715220) | |||
| - | Article (Xu, X., Zhao, S., Wei, J., Fang, N., Yin, L. and Sun, J. (2012) Porric acid D from marine-derived fungus Alternaria sp. isolated from Bohai Sea. Chem, Nat. Compd., 47(6), 893-895.) | ||
| - | PubMed (28300771) | Strain: NH-F6 | |
| - | PubMed (19835393) | ||
| Botryosphaeria dothidea (ncbitaxon:55169) | - | PubMed (24689437) | Strain: KJ-1 |
| Didymella glomerata (ncbitaxon:749621) | - | PubMed (27450949) | |
| Penicillium sp. (ncbitaxon:5081) | - | PubMed (28067492) | Strain: CVAL4 |
| Talaromyces flavus (ncbitaxon:5095) | - | Article (Ayer, W.A. and Racok, J.S. (1990) The metabolites of Talaromycesflavus: part 1. metabolites of the organic extracts. Can. J. Chem., 68(11), 2085-2094.) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| altenusin (CHEBI:141340) has role antifungal agent (CHEBI:35718) |
| altenusin (CHEBI:141340) has role fungal metabolite (CHEBI:76946) |
| altenusin (CHEBI:141340) is a aromatic ether (CHEBI:35618) |
| altenusin (CHEBI:141340) is a carboxybiphenyl (CHEBI:141493) |
| altenusin (CHEBI:141340) is a catechols (CHEBI:33566) |
| altenusin (CHEBI:141340) is a hydroxybiphenyls (CHEBI:24681) |
| altenusin (CHEBI:141340) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3,4',5'-trihydroxy-5-methoxy-2'-methyl[biphenyl]-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-(4,5-dihydroxy-2-methylphenyl)-6-hydroxy-4-methoxybenzoic acid | ChEBI |
| 2,4',5'-trihydroxy-5-methoxy-2'-methyl-(1,1'-biphenyl)-2-carboxylic acid | ChemIDplus |
| altenusin | ChemIDplus |
| alutenusin | ChemIDplus |
| MS 341 | ChemIDplus |
| MS-341 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00023666 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2223336 | Reaxys |
| CAS:31186-12-6 | ChemIDplus |
| Citations |
|---|