EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13ClO6 |
| Net Charge | 0 |
| Average Mass | 384.771 |
| Monoisotopic Mass | 384.04007 |
| SMILES | O=C1C(Cl)=CC2(Oc3cccc4cccc(c34)O2)[C@]23O[C@]12[C@H](O)CCC3=O |
| InChI | InChI=1S/C20H13ClO6/c21-11-9-18(20-15(23)8-7-14(22)19(20,27-20)17(11)24)25-12-5-1-3-10-4-2-6-13(26-18)16(10)12/h1-6,9,14,22H,7-8H2/t14-,19-,20+/m1/s1 |
| InChIKey | KDRDVNRYLTWNLC-XMCHAPAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Berkleasmium sp. (ncbitaxon:1950114) | - | PubMed (25237727) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmarumycin C8 (CHEBI:141339) has role antifungal agent (CHEBI:35718) |
| palmarumycin C8 (CHEBI:141339) has role fungal metabolite (CHEBI:76946) |
| palmarumycin C8 (CHEBI:141339) is a naphthalenes (CHEBI:25477) |
| palmarumycin C8 (CHEBI:141339) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|