EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13ClO6 |
| Net Charge | 0 |
| Average Mass | 384.771 |
| Monoisotopic Mass | 384.04007 |
| SMILES | O=C1C(Cl)=CC2(Oc3cccc4cccc(c34)O2)[C@]23O[C@]12[C@H](O)CCC3=O |
| InChI | InChI=1S/C20H13ClO6/c21-11-9-18(20-15(23)8-7-14(22)19(20,27-20)17(11)24)25-12-5-1-3-10-4-2-6-13(26-18)16(10)12/h1-6,9,14,22H,7-8H2/t14-,19-,20+/m1/s1 |
| InChIKey | KDRDVNRYLTWNLC-XMCHAPAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Berkleasmium sp. (ncbitaxon:1950114) | - | PubMed (25237727) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmarumycin C8 (CHEBI:141339) has role antifungal agent (CHEBI:35718) |
| palmarumycin C8 (CHEBI:141339) has role fungal metabolite (CHEBI:76946) |
| palmarumycin C8 (CHEBI:141339) is a naphthalenes (CHEBI:25477) |
| palmarumycin C8 (CHEBI:141339) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|