EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O4 |
| Net Charge | 0 |
| Average Mass | 238.283 |
| Monoisotopic Mass | 238.12051 |
| SMILES | [H][C@]12C(=C)C(=O)O[C@@]1([H])[C@@]([H])(CCCCCC)OC2=O |
| InChI | InChI=1S/C13H18O4/c1-3-4-5-6-7-9-11-10(13(15)16-9)8(2)12(14)17-11/h9-11H,2-7H2,1H3/t9-,10+,11+/m1/s1 |
| InChIKey | AENZSPQGLJVLND-VWYCJHECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulisporium sp. A21 (ncbitaxon:1647372) | - | PubMed (27017876) | |
| Sporothrix sp. (ncbitaxon:1902615) | - | PubMed (8119853) | Strain: 700 |
| Hypoxylon monticulosum (ncbitaxon:326669) | - | PubMed (29043802) | Strain: CLL-205 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sporothriolide (CHEBI:141338) has role antifungal agent (CHEBI:35718) |
| sporothriolide (CHEBI:141338) has role fungal metabolite (CHEBI:76946) |
| sporothriolide (CHEBI:141338) is a furofuran (CHEBI:47790) |
| sporothriolide (CHEBI:141338) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3aS,6R,6aR)-6-hexyl-3-methylenetetrahydrofuro[3,4-b]furan-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| C00016931 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6808451 | Reaxys |
| CAS:154799-92-5 | KNApSAcK |
| CAS:154799-92-5 | ChemIDplus |
| Citations |
|---|