EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COC1=CC2(C)OC(=O)c3c(O)cc(OC)cc3C2=C(O)C1=O |
| InChI | InChI=1S/C16H14O7/c1-16-6-10(22-3)13(18)14(19)12(16)8-4-7(21-2)5-9(17)11(8)15(20)23-16/h4-6,17,19H,1-3H3 |
| InChIKey | WNZWXVOIYRJRSM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyalodendriella sp. Ponipodef 12 (ncbitaxon:941079) | - | PubMed (23011274) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| botrallin (CHEBI:141337) has functional parent 6H-dibenzo[b,d]pyran-6-one (CHEBI:86511) |
| botrallin (CHEBI:141337) has role antifungal agent (CHEBI:35718) |
| botrallin (CHEBI:141337) has role antimicrobial agent (CHEBI:33281) |
| botrallin (CHEBI:141337) has role fungal metabolite (CHEBI:76946) |
| botrallin (CHEBI:141337) is a aromatic ether (CHEBI:35618) |
| botrallin (CHEBI:141337) is a benzochromene (CHEBI:38920) |
| botrallin (CHEBI:141337) is a enol (CHEBI:33823) |
| botrallin (CHEBI:141337) is a enol ether (CHEBI:47985) |
| botrallin (CHEBI:141337) is a organic heterotricyclic compound (CHEBI:26979) |
| botrallin (CHEBI:141337) is a organic hydroxy compound (CHEBI:33822) |
| botrallin (CHEBI:141337) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 1,7-dihydroxy-3,9-dimethoxy-4a-methyl-4aH-benzo[c]chromene-2,6-dione |
| Synonyms | Source |
|---|---|
| 1,7-dihydroxy-3,9-dimethoxy-4a-methylbenzo[c][1]benzopyran-2,6-dione | ChEBI |
| botrallin | ChEBI |
| Citations |
|---|