EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O7 |
| Net Charge | 0 |
| Average Mass | 318.281 |
| Monoisotopic Mass | 318.07395 |
| SMILES | COC1=CC2(C)OC(=O)c3c(O)cc(OC)cc3C2=C(O)C1=O |
| InChI | InChI=1S/C16H14O7/c1-16-6-10(22-3)13(18)14(19)12(16)8-4-7(21-2)5-9(17)11(8)15(20)23-16/h4-6,17,19H,1-3H3 |
| InChIKey | WNZWXVOIYRJRSM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyalodendriella sp. Ponipodef 12 (ncbitaxon:941079) | - | PubMed (23011274) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| botrallin (CHEBI:141337) has functional parent 6H-dibenzo[b,d]pyran-6-one (CHEBI:86511) |
| botrallin (CHEBI:141337) has role antifungal agent (CHEBI:35718) |
| botrallin (CHEBI:141337) has role antimicrobial agent (CHEBI:33281) |
| botrallin (CHEBI:141337) has role fungal metabolite (CHEBI:76946) |
| botrallin (CHEBI:141337) is a aromatic ether (CHEBI:35618) |
| botrallin (CHEBI:141337) is a benzochromene (CHEBI:38920) |
| botrallin (CHEBI:141337) is a enol (CHEBI:33823) |
| botrallin (CHEBI:141337) is a enol ether (CHEBI:47985) |
| botrallin (CHEBI:141337) is a organic heterotricyclic compound (CHEBI:26979) |
| botrallin (CHEBI:141337) is a organic hydroxy compound (CHEBI:33822) |
| botrallin (CHEBI:141337) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 1,7-dihydroxy-3,9-dimethoxy-4a-methyl-4aH-benzo[c]chromene-2,6-dione |
| Synonyms | Source |
|---|---|
| 1,7-dihydroxy-3,9-dimethoxy-4a-methylbenzo[c][1]benzopyran-2,6-dione | ChEBI |
| botrallin | ChEBI |
| Citations |
|---|