EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141335 - 4-hydroxymellein
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | CC1OC(=O)c2c(O)cccc2C1O |
| InChI | InChI=1S/C10H10O4/c1-5-9(12)6-3-2-4-7(11)8(6)10(13)14-5/h2-5,9,11-12H,1H3 |
| InChIKey | STSOHAOGZMLWFR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyalodendriella sp. Ponipodef 12 (ncbitaxon:941079) | - | PubMed (23011274) | |
| Biatriospora sp. (ncbitaxon:1933435) | - | PubMed (27556953) | Strain: 8331C |
| Illigera luzonensis (ncbitaxon:74946) | root (BTO:0001188) | PubMed (21315382) | |
| Xylaria longiana (ncbitaxon:1033816) | - | Article (Edwards, R.L., Maitland, D.J., Oliver, C.L., Pacey, M.S., Shields, L. and Whalley, A.J.S. (1999) Metabolites of the higher fungi. Part 31.1 Longianone, a C7H6O4 spiro bicyclic lactone from the fungus Xylaria longiana (Rehm.). J. Chem. Soc. Perkin Trans., 1(6), 715–719.) | |
| Aspergillus ochraceus (ncbitaxon:40380) | - | PubMed (5064985) | |
| Camponotus quadrisectus (ncbitaxon:450392) | - | PubMed (18213494) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxymellein (CHEBI:141335) has functional parent mellein (CHEBI:38760) |
| 4-hydroxymellein (CHEBI:141335) has role animal metabolite (CHEBI:75767) |
| 4-hydroxymellein (CHEBI:141335) has role antifungal agent (CHEBI:35718) |
| 4-hydroxymellein (CHEBI:141335) has role antimicrobial agent (CHEBI:33281) |
| 4-hydroxymellein (CHEBI:141335) has role fungal metabolite (CHEBI:76946) |
| 4-hydroxymellein (CHEBI:141335) has role plant metabolite (CHEBI:76924) |
| 4-hydroxymellein (CHEBI:141335) is a isochromanes (CHEBI:38762) |
| 4-hydroxymellein (CHEBI:141335) is a phenols (CHEBI:33853) |
| 4-hydroxymellein (CHEBI:141335) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 4,8-dihydroxy-3-methyl-3,4-dihydro-1H-2-benzopyran-1-one |
| Synonyms | Source |
|---|---|
| 4,8-dihydroxy-3-methylisochroman-1-one | ChEBI |
| 4-hydroxymellein | ChEBI |
| 4,8-dihydroxy-3-methylbenzopyran-1-one | ChEBI |
| 3-methyl-4,8-dihydroxy-3,4-dihydroisocoumarin | ChEBI |
| Citations |
|---|