EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | CC1OC(=O)c2c(O)cccc2C1O |
| InChI | InChI=1S/C10H10O4/c1-5-9(12)6-3-2-4-7(11)8(6)10(13)14-5/h2-5,9,11-12H,1H3 |
| InChIKey | STSOHAOGZMLWFR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus ochraceus (ncbitaxon:40380) | - | PubMed (5064985) | |
| Biatriospora sp. (ncbitaxon:1933435) | - | PubMed (27556953) | Strain: 8331C |
| Camponotus quadrisectus (ncbitaxon:450392) | - | PubMed (18213494) | |
| Hyalodendriella sp. Ponipodef 12 (ncbitaxon:941079) | - | PubMed (23011274) | |
| Illigera luzonensis (ncbitaxon:74946) | root (BTO:0001188) | PubMed (21315382) | |
| Xylaria longiana (ncbitaxon:1033816) | - | Article (Edwards, R.L., Maitland, D.J., Oliver, C.L., Pacey, M.S., Shields, L. and Whalley, A.J.S. (1999) Metabolites of the higher fungi. Part 31.1 Longianone, a C7H6O4 spiro bicyclic lactone from the fungus Xylaria longiana (Rehm.). J. Chem. Soc. Perkin Trans., 1(6), 715–719.) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxymellein (CHEBI:141335) has functional parent mellein (CHEBI:38760) |
| 4-hydroxymellein (CHEBI:141335) has role animal metabolite (CHEBI:75767) |
| 4-hydroxymellein (CHEBI:141335) has role antifungal agent (CHEBI:35718) |
| 4-hydroxymellein (CHEBI:141335) has role antimicrobial agent (CHEBI:33281) |
| 4-hydroxymellein (CHEBI:141335) has role fungal metabolite (CHEBI:76946) |
| 4-hydroxymellein (CHEBI:141335) has role plant metabolite (CHEBI:76924) |
| 4-hydroxymellein (CHEBI:141335) is a isochromanes (CHEBI:38762) |
| 4-hydroxymellein (CHEBI:141335) is a phenols (CHEBI:33853) |
| 4-hydroxymellein (CHEBI:141335) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 4,8-dihydroxy-3-methyl-3,4-dihydro-1H-2-benzopyran-1-one |
| Synonyms | Source |
|---|---|
| 3-methyl-4,8-dihydroxy-3,4-dihydroisocoumarin | ChEBI |
| 4,8-dihydroxy-3-methylbenzopyran-1-one | ChEBI |
| 4,8-dihydroxy-3-methylisochroman-1-one | ChEBI |
| 4-hydroxymellein | ChEBI |
| Citations |
|---|