EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11ClO5 |
| Net Charge | 0 |
| Average Mass | 306.701 |
| Monoisotopic Mass | 306.02950 |
| SMILES | COc1cc(O)c2c(=O)oc3cc(O)c(Cl)c(C)c3c2c1 |
| InChI | InChI=1S/C15H11ClO5/c1-6-12-8-3-7(20-2)4-9(17)13(8)15(19)21-11(12)5-10(18)14(6)16/h3-5,17-18H,1-2H3 |
| InChIKey | WMOJBLDBGQOTOS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyalodendriella sp. Ponipodef 12 (ncbitaxon:941079) | - | PubMed (23011274) | |
| Lachnum palmae (ncbitaxon:397619) | - | Article (Matsumoto, T., Hosoya, T. and Shigemori, H. (2010) Palmariols A and B, two new chlorinated dibenzo-α-pyrones from discomycete Lachnum palmae. Heterocycles, 81(5), 1231-1237.) | |
| Rhizopycnis sp. Nitaf22 (ncbitaxon:1549727) | - | PubMed (27441892) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmariol B (CHEBI:141334) has functional parent 6H-dibenzo[b,d]pyran-6-one (CHEBI:86511) |
| palmariol B (CHEBI:141334) has role antifungal agent (CHEBI:35718) |
| palmariol B (CHEBI:141334) has role antimicrobial agent (CHEBI:33281) |
| palmariol B (CHEBI:141334) has role fungal metabolite (CHEBI:76946) |
| palmariol B (CHEBI:141334) is a aromatic ether (CHEBI:35618) |
| palmariol B (CHEBI:141334) is a benzochromenone (CHEBI:64986) |
| palmariol B (CHEBI:141334) is a organic hydroxy compound (CHEBI:33822) |
| palmariol B (CHEBI:141334) is a organochlorine compound (CHEBI:36683) |
| palmariol B (CHEBI:141334) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 2-chloro-3,7-dihydroxy-9-methoxy-1-methyl-6H-benzo[c]chromen-6-one |
| Synonym | Source |
|---|---|
| 2-chloro-3,7-dihydroxy-9-methoxy-1-methyl-6H-dibenzo[b,d]pyran-6-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21206504 | Reaxys |
| Citations |
|---|