EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11ClO5 |
| Net Charge | 0 |
| Average Mass | 306.701 |
| Monoisotopic Mass | 306.02950 |
| SMILES | COc1cc(O)c2c(=O)oc3cc(O)c(Cl)c(C)c3c2c1 |
| InChI | InChI=1S/C15H11ClO5/c1-6-12-8-3-7(20-2)4-9(17)13(8)15(19)21-11(12)5-10(18)14(6)16/h3-5,17-18H,1-2H3 |
| InChIKey | WMOJBLDBGQOTOS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyalodendriella sp. Ponipodef 12 (ncbitaxon:941079) | - | PubMed (23011274) | |
| Lachnum palmae (ncbitaxon:397619) | - | Article (Matsumoto, T., Hosoya, T. and Shigemori, H. (2010) Palmariols A and B, two new chlorinated dibenzo-α-pyrones from discomycete Lachnum palmae. Heterocycles, 81(5), 1231-1237.) | |
| Rhizopycnis sp. Nitaf22 (ncbitaxon:1549727) | - | PubMed (27441892) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palmariol B (CHEBI:141334) has functional parent 6H-dibenzo[b,d]pyran-6-one (CHEBI:86511) |
| palmariol B (CHEBI:141334) has role antifungal agent (CHEBI:35718) |
| palmariol B (CHEBI:141334) has role antimicrobial agent (CHEBI:33281) |
| palmariol B (CHEBI:141334) has role fungal metabolite (CHEBI:76946) |
| palmariol B (CHEBI:141334) is a aromatic ether (CHEBI:35618) |
| palmariol B (CHEBI:141334) is a benzochromenone (CHEBI:64986) |
| palmariol B (CHEBI:141334) is a organic hydroxy compound (CHEBI:33822) |
| palmariol B (CHEBI:141334) is a organochlorine compound (CHEBI:36683) |
| palmariol B (CHEBI:141334) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 2-chloro-3,7-dihydroxy-9-methoxy-1-methyl-6H-benzo[c]chromen-6-one |
| Synonym | Source |
|---|---|
| 2-chloro-3,7-dihydroxy-9-methoxy-1-methyl-6H-dibenzo[b,d]pyran-6-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21206504 | Reaxys |
| Citations |
|---|