EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11ClO5 |
| Net Charge | 0 |
| Average Mass | 306.701 |
| Monoisotopic Mass | 306.02950 |
| SMILES | COc1cc2oc(=O)c3c(O)cc(O)cc3c2c(C)c1Cl |
| InChI | InChI=1S/C15H11ClO5/c1-6-12-8-3-7(17)4-9(18)13(8)15(19)21-10(12)5-11(20-2)14(6)16/h3-5,17-18H,1-2H3 |
| InChIKey | SQHXETAXRBEYRI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyalodendriella sp. Ponipodef 12 (ncbitaxon:941079) | - | PubMed (27862895) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyalodendriol C (CHEBI:141333) has functional parent 6H-dibenzo[b,d]pyran-6-one (CHEBI:86511) |
| hyalodendriol C (CHEBI:141333) has role fungal metabolite (CHEBI:76946) |
| hyalodendriol C (CHEBI:141333) is a aromatic ether (CHEBI:35618) |
| hyalodendriol C (CHEBI:141333) is a benzochromenone (CHEBI:64986) |
| hyalodendriol C (CHEBI:141333) is a organic heterotricyclic compound (CHEBI:26979) |
| hyalodendriol C (CHEBI:141333) is a organic hydroxy compound (CHEBI:33822) |
| hyalodendriol C (CHEBI:141333) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-chloro-7,9-dihydroxy-3-methoxy-1-methyl-6H-benzo[c]chromen-6-one |
| Citations |
|---|