EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O6 |
| Net Charge | 0 |
| Average Mass | 324.373 |
| Monoisotopic Mass | 324.15729 |
| SMILES | [H][C@@]12CC3=C(O[C@]1(C)CC[C@@]2([H])[C@](C)(O)CO)[C@@H]1C[C@@](O)(CO1)C3=O |
| InChI | InChI=1S/C17H24O6/c1-15(20,7-18)10-3-4-16(2)11(10)5-9-13(23-16)12-6-17(21,8-22-12)14(9)19/h10-12,18,20-21H,3-8H2,1-2H3/t10-,11+,12+,15-,16-,17-/m1/s1 |
| InChIKey | OPYPWMGWBUCOSQ-RZNLEFLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium sp. (ncbitaxon:29916) | cell suspension culture (BTO:0000221) | PubMed (35541335 ) | |
| Guignardia sp. (ncbitaxon:1715232) | cell suspension culture (BTO:0000221) | PubMed (26577190) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guignardone N (CHEBI:141332) has role antifungal agent (CHEBI:35718) |
| guignardone N (CHEBI:141332) has role fungal metabolite (CHEBI:76946) |
| guignardone N (CHEBI:141332) is a meroterpenoid (CHEBI:64419) |
| guignardone N (CHEBI:141332) is a organic heterotetracyclic compound (CHEBI:38163) |
| guignardone N (CHEBI:141332) is a organic hydroxy compound (CHEBI:33822) |
| guignardone N (CHEBI:141332) is a primary alcohol (CHEBI:15734) |
| guignardone N (CHEBI:141332) is a tertiary alcohol (CHEBI:26878) |
| guignardone N (CHEBI:141332) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| guignardone N (CHEBI:141332) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1S,4R,6aS,7R,9aR)-7-[(2S)-1,2-dihydroxypropan-2-yl]-4-hydroxy-9a-methyl-3,4,6,6a,7,8,9,9a-octahydro-1,4-methanocyclopenta[5,6]pyrano[2,3-c]oxepin-5(1H)-one |
| Synonym | Source |
|---|---|
| guignardone N | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28851661 | Reaxys |
| Citations |
|---|