EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O6 |
| Net Charge | 0 |
| Average Mass | 352.342 |
| Monoisotopic Mass | 352.09469 |
| SMILES | [H][C@]12c3ccc(O)c4c3[C@]([H])(c3ccc(O)c(c31)C(=O)C[C@@H]2O)[C@@H](O)CC4=O |
| InChI | InChI=1S/C20H16O6/c21-9-3-1-7-15-11(23)5-14(26)20-10(22)4-2-8(18(15)20)16-12(24)6-13(25)19(9)17(7)16/h1-4,11-12,15-16,21-24H,5-6H2/t11-,12-,15+,16+/m0/s1 |
| InChIKey | MCWOXLPZYFOWRX-YXAMBPQSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria tenuissima (ncbitaxon:119927) | - | PubMed (25920216) | |
| Botryosphaeria dothidea (ncbitaxon:55169) | - | PubMed (24689437) | Strain: KJ-1 |
| Talaromyces sp. ZH154 (ncbitaxon:560351) | - | PubMed (19670161) | Isolated from stem bark of isolated from the stem bark of Kandelia candel |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stemphyperylenol (CHEBI:141330) has role antifungal agent (CHEBI:35718) |
| stemphyperylenol (CHEBI:141330) has role fungal metabolite (CHEBI:76946) |
| stemphyperylenol (CHEBI:141330) is a aromatic ketone (CHEBI:76224) |
| stemphyperylenol (CHEBI:141330) is a organic polycyclic compound (CHEBI:51958) |
| stemphyperylenol (CHEBI:141330) is a phenols (CHEBI:33853) |
| stemphyperylenol (CHEBI:141330) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,6bS,7S,12bS)-1,4,7,10-tetrahydroxy-1,2,6b,7,8,12b-hexahydroperylene-3,9-dione |
| Synonym | Source |
|---|---|
| (+)-stemphyperylenol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:102694-33-7 | ChemIDplus |
| Citations |
|---|