EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141330 - stemphyperylenol
| Formula | C20H16O6 |
| Net Charge | 0 |
| Average Mass | 352.342 |
| Monoisotopic Mass | 352.09469 |
| SMILES | [H][C@]12c3ccc(O)c4c3[C@]([H])(c3ccc(O)c(c31)C(=O)C[C@@H]2O)[C@@H](O)CC4=O |
| InChI | InChI=1S/C20H16O6/c21-9-3-1-7-15-11(23)5-14(26)20-10(22)4-2-8(18(15)20)16-12(24)6-13(25)19(9)17(7)16/h1-4,11-12,15-16,21-24H,5-6H2/t11-,12-,15+,16+/m0/s1 |
| InChIKey | MCWOXLPZYFOWRX-YXAMBPQSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria tenuissima (ncbitaxon:119927) | - | PubMed (25920216) | |
| Botryosphaeria dothidea (ncbitaxon:55169) | - | PubMed (24689437) | Strain: KJ-1 |
| Talaromyces sp. ZH154 (ncbitaxon:560351) | - | PubMed (19670161) | Isolated from stem bark of isolated from the stem bark of Kandelia candel |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stemphyperylenol (CHEBI:141330) has role antifungal agent (CHEBI:35718) |
| stemphyperylenol (CHEBI:141330) has role fungal metabolite (CHEBI:76946) |
| stemphyperylenol (CHEBI:141330) is a aromatic ketone (CHEBI:76224) |
| stemphyperylenol (CHEBI:141330) is a organic polycyclic compound (CHEBI:51958) |
| stemphyperylenol (CHEBI:141330) is a phenols (CHEBI:33853) |
| stemphyperylenol (CHEBI:141330) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,6bS,7S,12bS)-1,4,7,10-tetrahydroxy-1,2,6b,7,8,12b-hexahydroperylene-3,9-dione |
| Synonym | Source |
|---|---|
| (+)-stemphyperylenol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:102694-33-7 | ChemIDplus |
| Citations |
|---|