EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | [H][C@]12[C@@H]3OC(=O)[C@@]1(C)CCC[C@]2(C)C1=CC(=O)OC[C@@]1(O)[C@@H]3O |
| InChI | InChI=1S/C16H20O6/c1-14-4-3-5-15(2)11(14)10(22-13(15)19)12(18)16(20)7-21-9(17)6-8(14)16/h6,10-12,18,20H,3-5,7H2,1-2H3/t10-,11+,12+,14+,15-,16-/m0/s1 |
| InChIKey | YSEQPMYIGMORKQ-DIEKJCKJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botryosphaeria sp. P483 (ncbitaxon:1820283) | - | PubMed (26393542) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| botryosphaerin H (CHEBI:141329) has role antifungal agent (CHEBI:35718) |
| botryosphaerin H (CHEBI:141329) has role fungal metabolite (CHEBI:76946) |
| botryosphaerin H (CHEBI:141329) is a organic heterotetracyclic compound (CHEBI:38163) |
| botryosphaerin H (CHEBI:141329) is a tetracyclic diterpenoid (CHEBI:52557) |
| botryosphaerin H (CHEBI:141329) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (3aS,5aS,6R,6aR,10bS,10cR)-6,6a-dihydroxy-3a,10b-dimethyl-1,2,3,3a,5a,6,6a,7,10b,10c-decahydro-4H,9H-[2]benzofuro[7,1-fg]isochromene-4,9-dione |
| Synonym | Source |
|---|---|
| (3aS,5aS,6R,6aR,10bS,10cR)-6,6a-dihydroxy-3a,10b-dimethyl-1,2,3,3a,5a,6,6a,7,10b,10c-decahydro-4H,9H-furo[2',3',4':4,5]naphtho[2,1-c]pyran-4,9-dione | IUPAC |
| Citations |
|---|