EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O9 |
| Net Charge | 0 |
| Average Mass | 392.360 |
| Monoisotopic Mass | 392.11073 |
| SMILES | COc1cc(O)c2c(=O)oc3c(c2c1)[C@@](C)(O)C[C@@H](OC)[C@@]31C[C@@H](O)C(=O)O1 |
| InChI | InChI=1S/C19H20O9/c1-18(24)7-12(26-3)19(6-11(21)16(22)28-19)15-14(18)9-4-8(25-2)5-10(20)13(9)17(23)27-15/h4-5,11-12,20-21,24H,6-7H2,1-3H3/t11-,12-,18+,19+/m1/s1 |
| InChIKey | DXDVGVFRBGQXNB-WPZAJUNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhizopycnis vagum (ncbitaxon:1589764) | - | PubMed (27441892) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhizopycnolide A (CHEBI:141316) has role antifungal agent (CHEBI:35718) |
| rhizopycnolide A (CHEBI:141316) has role fungal metabolite (CHEBI:76946) |
| rhizopycnolide A (CHEBI:141316) is a benzochromene (CHEBI:38920) |
| rhizopycnolide A (CHEBI:141316) is a oxaspiro compound (CHEBI:37948) |
| rhizopycnolide A (CHEBI:141316) is a secondary alcohol (CHEBI:35681) |
| rhizopycnolide A (CHEBI:141316) is a tertiary alcohol (CHEBI:26878) |
| rhizopycnolide A (CHEBI:141316) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (1S,3R,4S,4'R)-1,4',7-trihydroxy-3,9-dimethoxy-1-methyl-2,3,3',4'-tetrahydro-1H,5'H,6H-spiro[benzo[c]chromene-4,2'-furan]-5',6-dione |
| Citations |
|---|