EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | Oc1ccc(C2OCC3OC3O2)cc1 |
| InChI | InChI=1S/C10H10O4/c11-7-3-1-6(2-4-7)9-12-5-8-10(13-8)14-9/h1-4,8-11H,5H2 |
| InChIKey | VAVWPUISYXXUCV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis mangiferae (ncbitaxon:748176) | - | PubMed (22950879) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(2,4,7-trioxa-bicyclo[4.1.0]heptan-3-yl)phenol (CHEBI:141302) has role antifungal agent (CHEBI:35718) |
| 4-(2,4,7-trioxa-bicyclo[4.1.0]heptan-3-yl)phenol (CHEBI:141302) has role fungal metabolite (CHEBI:76946) |
| 4-(2,4,7-trioxa-bicyclo[4.1.0]heptan-3-yl)phenol (CHEBI:141302) is a cyclic acetal (CHEBI:59770) |
| 4-(2,4,7-trioxa-bicyclo[4.1.0]heptan-3-yl)phenol (CHEBI:141302) is a epoxide (CHEBI:32955) |
| 4-(2,4,7-trioxa-bicyclo[4.1.0]heptan-3-yl)phenol (CHEBI:141302) is a oxabicycloalkane (CHEBI:46733) |
| 4-(2,4,7-trioxa-bicyclo[4.1.0]heptan-3-yl)phenol (CHEBI:141302) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-(2,4,7-trioxabicyclo[4.1.0]heptan-3-yl)phenol |
| Citations |
|---|