EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O2 |
| Net Charge | 0 |
| Average Mass | 168.236 |
| Monoisotopic Mass | 168.11503 |
| SMILES | CC1=CC[C@H]([C@@H](C)C(=O)O)CC1 |
| InChI | InChI=1S/C10H16O2/c1-7-3-5-9(6-4-7)8(2)10(11)12/h3,8-9H,4-6H2,1-2H3,(H,11,12)/t8-,9+/m1/s1 |
| InChIKey | QOGOGJNRMJOCKH-BDAKNGLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neopestalotiopsis foedans (ncbitaxon:290095) | - | PubMed (27448166) | Obtained from the branch of Bruguiera sexangula |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propanoic acid (CHEBI:141292) has role antifungal agent (CHEBI:35718) |
| (2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propanoic acid (CHEBI:141292) has role fungal metabolite (CHEBI:76946) |
| (2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propanoic acid (CHEBI:141292) is a monocarboxylic acid (CHEBI:25384) |
| (2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propanoic acid (CHEBI:141292) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| (2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-[(1R)-4-methylcyclohex-3-en-1-yl]propionic acid | IUPAC |
| (+)-(4R,8R)-Δ1-p-menthen-9-carboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7014122 | Reaxys |
| Citations |
|---|