EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C/C=C(C)/C=C/C=C(C)C |
| InChI | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5-8H,1-4H3/b8-6+,10-5+ |
| InChIKey | GQVMHMFBVWSSPF-SOYUKNQTSA-N |
| Roles Classification |
|---|
| Biological Roles: | semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4E,6E)-2,6-dimethylocta-2,4,6-triene (CHEBI:141222) has role semiochemical (CHEBI:26645) |
| (4E,6E)-2,6-dimethylocta-2,4,6-triene (CHEBI:141222) is a ocimene (CHEBI:87751) |
| IUPAC Name |
|---|
| (4E,6E)-2,6-dimethylocta-2,4,6-triene |
| Synonyms | Source |
|---|---|
| (4E,6E)-allocimene | ChemIDplus |
| (4E,6E)-allo-ocimene | ChEBI |
| (4E,6E)-alloocimene | ChemIDplus |
| (E,E)-2,6-dimethyl-2,4,6-octatriene | ChemIDplus |
| (E,E)-2,6-dimethyl-2,4,6-octatriene | ChEBI |
| trans-allo-ocimene | ChEBI |
| UniProt Name | Source |
|---|---|
| (4E,6E)-allo-ocimene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA11000042 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1719993 | Reaxys |
| CAS:14947-20-7 | NIST Chemistry WebBook |
| CAS:3016-19-1 | ChemIDplus |