EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | C=C[C@]1(C)CC[C@@H](C(C)(C)O)C[C@H]1C(=C)C |
| InChI | InChI=1S/C15H26O/c1-7-15(6)9-8-12(14(4,5)16)10-13(15)11(2)3/h7,12-13,16H,1-2,8-10H2,3-6H3/t12-,13+,15-/m1/s1 |
| InChIKey | GFJIQNADMLPFOW-VNHYZAJKSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elemol (CHEBI:141221) has role fragrance (CHEBI:48318) |
| elemol (CHEBI:141221) has role plant metabolite (CHEBI:76924) |
| elemol (CHEBI:141221) is a olefinic compound (CHEBI:78840) |
| elemol (CHEBI:141221) is a sesquiterpenoid (CHEBI:26658) |
| elemol (CHEBI:141221) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Names |
|---|
| 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-(prop-1-en-2-yl)cyclohexyl]propan-2-ol |
| 2-[(1R,3S,4S)-4-methyl-3-(prop-1-en-2-yl)-4-vinylcyclohexyl]propan-2-ol |
| Synonyms | Source |
|---|---|
| (1R,3S,4S)-4-ethenyl-α,α,4-trimethyl-3-(1-methylethenyl)cyclohexanemethanol | ChemIDplus |
| 1R,1α,3α,4β-4-ethenyl-α,α,4-trimethyl-3-(1-methylethenyl)cyclohexanemethanol | NIST Chemistry WebBook |
| (1S,2S,4R)-(−)-α,α-dimethyl-1-vinyl-o-menth-8-ene-4-methanol | NIST Chemistry WebBook |
| Citations |
|---|