EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O2 |
| Net Charge | 0 |
| Average Mass | 152.193 |
| Monoisotopic Mass | 152.08373 |
| SMILES | COc1cc(C)cc(OC)c1 |
| InChI | InChI=1S/C9H12O2/c1-7-4-8(10-2)6-9(5-7)11-3/h4-6H,1-3H3 |
| InChIKey | RIZBLVRXRWHLFA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dimethoxytoluene (CHEBI:141217) has role fragrance (CHEBI:48318) |
| 3,5-dimethoxytoluene (CHEBI:141217) has role plant metabolite (CHEBI:76924) |
| 3,5-dimethoxytoluene (CHEBI:141217) is a methoxybenzenes (CHEBI:51683) |
| 3,5-dimethoxytoluene (CHEBI:141217) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 1,3-dimethoxy-5-methylbenzene |
| Synonyms | Source |
|---|---|
| 1,5-dimethoxy-3-methylbenzene | NIST Chemistry WebBook |
| 5-methylresorcinol dimethyl ether | NIST Chemistry WebBook |
| DMT | NIST Chemistry WebBook |
| orcinol dimethyl ether | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| 3,5-dimethoxytoluene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9502 | MetaCyc |
| HMDB0059853 | HMDB |
| Citations |
|---|