EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12F3NO4S |
| Net Charge | 0 |
| Average Mass | 359.325 |
| Monoisotopic Mass | 359.04391 |
| SMILES | CS(=O)(=O)c1cc(C(F)(F)F)ccc1C(=O)C(C#N)C(=O)C1CC1 |
| InChI | InChI=1S/C15H12F3NO4S/c1-24(22,23)12-6-9(15(16,17)18)4-5-10(12)14(21)11(7-19)13(20)8-2-3-8/h4-6,8,11H,2-3H2,1H3 |
| InChIKey | ZTTKDUXKVPEXCG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) has role agrochemical (CHEBI:33286) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) has role herbicide (CHEBI:24527) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) is a aromatic ketone (CHEBI:76224) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) is a cyclopropanes (CHEBI:51454) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) is a nitrile (CHEBI:18379) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) is a sulfone (CHEBI:35850) |
| 2-cyano-3-cyclopropyl-1-(2-mesyl-4-trifluoromethylphenyl)propan-1,3-dione (CHEBI:141214) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 3-cyclopropyl-2-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]-3-oxopropanenitrile |
| Synonyms | Source |
|---|---|
| 2-cyano-3-cyclopropyl-1-[2-(methylsulphonyl)-4-trifluoromethylphenyl] propan-1,3-dione | ChEBI |
| 3-cyclopropyl-1-(α,α,α-trifluoro-2-mesyl-p-tolyl)-1,3-dioxopropane-2-nitrile | ChEBI |
| diketonitrile | ChEBI |
| RPA-202248 | ChemIDplus |
| α-(cyclopropylcarbonyl)-2-(methylsulfonyl)-β-oxo-4-(trifluoromethyl)benzenepropanenitrile | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8344612 | Reaxys |
| CAS:143701-75-1 | ChemIDplus |
| Citations |
|---|