EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12F3NO4S |
| Net Charge | 0 |
| Average Mass | 359.325 |
| Monoisotopic Mass | 359.04391 |
| SMILES | CS(=O)(=O)c1cc(C(F)(F)F)ccc1C(=O)c1cnoc1C1CC1 |
| InChI | InChI=1S/C15H12F3NO4S/c1-24(21,22)12-6-9(15(16,17)18)4-5-10(12)13(20)11-7-19-23-14(11)8-2-3-8/h4-8H,2-3H2,1H3 |
| InChIKey | OYIKARCXOQLFHF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor An EC 1.13.11.* (oxidoreductase acting on single donors and incorporating 2 atoms of oxygen) inhibitor that interferes with the activity of 4-hydroxyphenylpyruvate dioxygenase (EC 1.13.11.27). |
| Applications: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoxaflutole (CHEBI:141213) has role agrochemical (CHEBI:33286) |
| isoxaflutole (CHEBI:141213) has role EC 1.13.11.27 (4-hydroxyphenylpyruvate dioxygenase) inhibitor (CHEBI:38317) |
| isoxaflutole (CHEBI:141213) has role proherbicide (CHEBI:136646) |
| isoxaflutole (CHEBI:141213) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| isoxaflutole (CHEBI:141213) is a aromatic ketone (CHEBI:76224) |
| isoxaflutole (CHEBI:141213) is a cyclopropanes (CHEBI:51454) |
| isoxaflutole (CHEBI:141213) is a isoxazoles (CHEBI:55373) |
| isoxaflutole (CHEBI:141213) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| (5-cyclopropyl-1,2-oxazol-4-yl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]methanone |
| Synonyms | Source |
|---|---|
| 5-cyclopropyl-1,2-oxazol-4-yl α,α,α-trifluoro-2-mesyl-p-tolyl ketone | ChEBI |
| (5-cyclopropyl-1,2-oxazol-4-yl)(α,α,α-trifluoro-2-mesyl-p-tolyl)methanone | ChEBI |
| 5-cyclopropyl-4-[2-methanesulfonyl-4-(trifluoromethyl)benzoyl]-1,2-oxazole | DrugBank |
| (5-cyclopropyl-4-isoxazolyl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]methanone | Alan Wood's Pesticides |
| (5-cyclopropylisoxazol-4-yl)(α,α,α-trifluoro-2-mesyl-p-tolyl)methanone | IUPAC |
| EXP 31130A | ChemIDplus |
| Brand Names | Source |
|---|---|
| Balance | DrugBank |
| Merlin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8344543 | Reaxys |
| CAS:141112-29-0 | NIST Chemistry WebBook |
| CAS:141112-29-0 | ChemIDplus |
| Citations |
|---|