EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O3 |
| Net Charge | -1 |
| Average Mass | 101.081 |
| Monoisotopic Mass | 101.02442 |
| SMILES | C[C@H](C=O)C(=O)[O-] |
| InChI | InChI=1S/C4H6O3/c1-3(2-5)4(6)7/h2-3H,1H3,(H,6,7)/p-1/t3-/m1/s1 |
| InChIKey | VOKUMXABRRXHAR-GSVOUGTGSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-methylmalonate semialdehyde (CHEBI:141212) is a 2-methyl-3-oxopropanoate (CHEBI:57700) |
| (R)-methylmalonate semialdehyde (CHEBI:141212) is enantiomer of (S)-methylmalonate semialdehyde (CHEBI:62413) |
| Incoming Relation(s) |
| (S)-methylmalonate semialdehyde (CHEBI:62413) is enantiomer of (R)-methylmalonate semialdehyde (CHEBI:141212) |
| UniProt Name | Source |
|---|---|
| (R)-2-methyl-3-oxopropanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12177 | MetaCyc |